Skip to main content

Binomial Expansion

Board Coverage

BoardPaperNotes
AQAPaper 1, 2Binomial theorem for positive integer nn; P2: general expansion
EdexcelP1, P2P1: positive integer; P2: negative/fractional
OCR (A)Paper 1, 2Similar split
CIE (9709)P1, P3P1: positive integer; P3: general
info

AQA provides the binomial expansion formula in the formula booklet. Edexcel does not — memorise it.


1. Pascal's Triangle

Pascal's triangle displays the binomial coefficients for successive powers of (a+b)n(a + b)^n:

n=0:1n=1:11n=2:121n=3:1331n=4:14641\begin{array}{c} n = 0: \quad 1 \\ n = 1: \quad 1 \quad 1 \\ n = 2: \quad 1 \quad 2 \quad 1 \\ n = 3: \quad 1 \quad 3 \quad 3 \quad 1 \\ n = 4: \quad 1 \quad 4 \quad 6 \quad 4 \quad 1 \\ \end{array}

Each entry is the sum of the two entries above it.


2. Binomial Coefficients

Definition. The binomial coefficient (nr)\binom{n}{r} (read "nn choose rr") is defined for non-negative integers n,rn, r with rnr \leq n by:

(nr)=n!r!(nr)!\binom{n}{r} = \frac{n!}{r!(n - r)!}

where n!=n(n1)(n2)1n! = n(n-1)(n-2)\cdots 1 is the factorial of nn, and 0!=10! = 1.

Theorem. (nr)\binom{n}{r} counts the number of ways to choose rr objects from nn distinct objects (order does not matter).

Proof. We count the number of ways to form a subset of size rr from {1,2,,n}\{1, 2, \ldots, n\}.

The number of ordered selections of rr objects from nn is n(n1)(nr+1)=n!(nr)!n(n-1)\cdots(n-r+1) = \frac{n!}{(n-r)!}.

But each subset of size rr can be ordered in r!r! ways. Dividing by r!r! (to account for overcounting):

(nr)=n!r!(nr)!\binom{n}{r} = \frac{n!}{r!(n-r)!} \quad \blacksquare

2.1 Properties of Binomial Coefficients

Theorem (Symmetry). (nr)=(nnr)\binom{n}{r} = \binom{n}{n - r}.

Proof. (nnr)=n!(nr)!(n(nr))!=n!(nr)!r!=(nr)\binom{n}{n-r} = \frac{n!}{(n-r)!(n - (n-r))!} = \frac{n!}{(n-r)!\,r!} = \binom{n}{r}. \blacksquare

Intuition. Choosing rr objects to include is equivalent to choosing nrn - r objects to exclude.

Theorem (Pascal's Identity). (nr)=(n1r)+(n1r1)\binom{n}{r} = \binom{n-1}{r} + \binom{n-1}{r-1}.

Proof. Consider a set of nn elements, with one distinguished element xx. To choose rr elements:

  • Case 1: Include xx. Choose r1r - 1 more from the remaining n1n - 1: (n1r1)\binom{n-1}{r-1} ways.
  • Case 2: Exclude xx. Choose all rr from the remaining n1n - 1: (n1r)\binom{n-1}{r} ways.

Total: (n1r1)+(n1r)\binom{n-1}{r-1} + \binom{n-1}{r}. \blacksquare


3. The Binomial Theorem

Theorem (Binomial Theorem for Positive Integer nn). For nNn \in \mathbb{N}:

(a+b)n=r=0n(nr)anrbr(a + b)^n = \sum_{r=0}^{n} \binom{n}{r} a^{n-r} b^r

=an+(n1)an1b+(n2)an2b2++(nn1)abn1+bn= a^n + \binom{n}{1}a^{n-1}b + \binom{n}{2}a^{n-2}b^2 + \cdots + \binom{n}{n-1}ab^{n-1} + b^n

Proof (by induction on nn).

Base case (n=0n = 0): (a+b)0=1=(00)a0b0(a+b)^0 = 1 = \binom{0}{0}a^0 b^0. ✓

Base case (n=1n = 1): (a+b)1=a+b=(10)a+(11)b(a+b)^1 = a + b = \binom{1}{0}a + \binom{1}{1}b. ✓

Inductive step: Assume (a+b)k=r=0k(kr)akrbr(a+b)^k = \sum_{r=0}^{k} \binom{k}{r} a^{k-r} b^r.

(a+b)k+1=(a+b)(a+b)k=(a+b)r=0k(kr)akrbr=r=0k(kr)ak+1rbr+r=0k(kr)akrbr+1=ak+1+r=1k(kr)ak+1rbr+r=1k+1(kr1)ak+1rbr+bk+1=ak+1+r=1k[(kr)+(kr1)]ak+1rbr+bk+1\begin{aligned} (a+b)^{k+1} &= (a+b)(a+b)^k \\ &= (a+b)\sum_{r=0}^{k} \binom{k}{r} a^{k-r} b^r \\ &= \sum_{r=0}^{k} \binom{k}{r} a^{k+1-r} b^r + \sum_{r=0}^{k} \binom{k}{r} a^{k-r} b^{r+1} \\ &= a^{k+1} + \sum_{r=1}^{k} \binom{k}{r} a^{k+1-r} b^r + \sum_{r=1}^{k+1} \binom{k}{r-1} a^{k+1-r} b^r + b^{k+1} \\ &= a^{k+1} + \sum_{r=1}^{k} \left[\binom{k}{r} + \binom{k}{r-1}\right] a^{k+1-r} b^r + b^{k+1} \end{aligned}

By Pascal's identity, (kr)+(kr1)=(k+1r)\binom{k}{r} + \binom{k}{r-1} = \binom{k+1}{r}:

=ak+1+r=1k(k+1r)ak+1rbr+bk+1=r=0k+1(k+1r)ak+1rbr= a^{k+1} + \sum_{r=1}^{k} \binom{k+1}{r} a^{k+1-r} b^r + b^{k+1} = \sum_{r=0}^{k+1} \binom{k+1}{r} a^{k+1-r} b^r \quad \blacksquare

Intuition. Each term in the expansion corresponds to a way of choosing aa's and bb's: from nn factors of (a+b)(a + b), choosing rr of them to contribute a bb (and the remaining nrn - r to contribute an aa) gives the term (nr)anrbr\binom{n}{r} a^{n-r} b^r.

Details

Example Expand (2x3)5(2x - 3)^5.

(2x3)5=r=05(5r)(2x)5r(3)r(2x - 3)^5 = \sum_{r=0}^{5} \binom{5}{r} (2x)^{5-r}(-3)^r

=32x5+516x4(3)+108x39+104x2(27)+52x81+(243)= 32x^5 + 5 \cdot 16x^4(-3) + 10 \cdot 8x^3 \cdot 9 + 10 \cdot 4x^2(-27) + 5 \cdot 2x \cdot 81 + (-243)

=32x5240x4+720x31080x2+810x243= 32x^5 - 240x^4 + 720x^3 - 1080x^2 + 810x - 243


4. General Binomial Expansion

When nn is not a positive integer (e.g., nn is negative or fractional), the expansion becomes an infinite series.

Theorem (General Binomial Theorem). For x<1|x| \lt 1 and any nRn \in \mathbb{R}:

(1+x)n=1+nx+n(n1)2!x2+n(n1)(n2)3!x3+(1 + x)^n = 1 + nx + \frac{n(n-1)}{2!}x^2 + \frac{n(n-1)(n-2)}{3!}x^3 + \cdots

=r=0(nr)xr= \sum_{r=0}^{\infty} \binom{n}{r} x^r

where (nr)=LBn(n1)(n2)(nr+1)RB◆◆LBr!RB\binom{n}{r} = \frac◆LB◆n(n-1)(n-2)\cdots(n-r+1)◆RB◆◆LB◆r!◆RB◆.

Note. When nn is a positive integer, the series terminates at r=nr = n (since (nr)=0\binom{n}{r} = 0 for r>nr \gt n). When nn is not a positive integer, the series is infinite.

Convergence. The series converges when x<1|x| \lt 1. This condition is essential.

Details

Example Find the expansion of (12x)3(1 - 2x)^{-3} up to and including the term in x3x^3.

Here n=3n = -3 and we replace xx with 2x-2x.

(12x)3=1+(3)(2x)+(3)(4)2!(2x)2+(3)(4)(5)3!(2x)3+=1+6x+122(4x2)+606(8x3)+=1+6x+24x2+80x3+\begin{aligned} (1 - 2x)^{-3} &= 1 + (-3)(-2x) + \frac{(-3)(-4)}{2!}(-2x)^2 + \frac{(-3)(-4)(-5)}{3!}(-2x)^3 + \cdots \\ &= 1 + 6x + \frac{12}{2}(4x^2) + \frac{-60}{6}(-8x^3) + \cdots \\ &= 1 + 6x + 24x^2 + 80x^3 + \cdots \end{aligned}

Valid for 2x<1|-2x| \lt 1, i.e., x<12|x| \lt \frac{1}{2}.

4.1 Expanding (a+bx)n(a + bx)^n

To expand (a+bx)n(a + bx)^n, first factor out aa:

(a+bx)n=an(1+bax)n(a + bx)^n = a^n\left(1 + \frac{b}{a}x\right)^n

Then expand (1+bax)n\left(1 + \frac{b}{a}x\right)^n using the general binomial theorem. The convergence condition becomes bax<1\left|\frac{b}{a}x\right| \lt 1.

Details

Example Expand 4+x\sqrt{4 + x} in ascending powers of xx up to x2x^2.

(4+x)1/2=41/2(1+x4)1/2=2[1+12x4+LB12(12)RB◆◆LB2!RBx216+]=2[1+x8x2128+]=2+x4x264+\begin{aligned} (4 + x)^{1/2} &= 4^{1/2}\left(1 + \frac{x}{4}\right)^{1/2} \\ &= 2\left[1 + \frac{1}{2}\cdot\frac{x}{4} + \frac◆LB◆\frac{1}{2}\cdot\left(-\frac{1}{2}\right)◆RB◆◆LB◆2!◆RB◆\cdot\frac{x^2}{16} + \cdots\right] \\ &= 2\left[1 + \frac{x}{8} - \frac{x^2}{128} + \cdots\right] \\ &= 2 + \frac{x}{4} - \frac{x^2}{64} + \cdots \end{aligned}

Valid for x4<1\left|\frac{x}{4}\right| \lt 1, i.e., x<4|x| \lt 4.


5. Finding Specific Terms

5.1 The General Term

In the expansion of (a+bx)n(a + bx)^n, the (r+1)(r+1)th term is:

Tr+1=(nr)anr(bx)rT_{r+1} = \binom{n}{r} a^{n-r}(bx)^r

The index rr counts from 00, so the first term corresponds to r=0r = 0 and the last term (when nn is a positive integer) corresponds to r=nr = n.

5.2 Strategy for Finding a Specific Term

To find the coefficient of xkx^k in (a+bx)n(a + bx)^n:

  1. Write the general term: Tr+1=(nr)anrbrxrT_{r+1} = \binom{n}{r} a^{n-r} b^r x^r.
  2. Set the power of xx equal to kk: r=kr = k.
  3. Substitute r=kr = k and evaluate.

When nn is not a positive integer, the general term still works — but you must also check convergence (bx/a<1|bx/a| \lt 1).

Details

Example 1: Constant term Find the constant term in the expansion of (x2+2x)8\left(x^2 + \frac{2}{x}\right)^8.

The general term is:

Tr+1=(8r)(x2)8r(2x)r=(8r)2rx163rT_{r+1} = \binom{8}{r} (x^2)^{8-r}\left(\frac{2}{x}\right)^r = \binom{8}{r} 2^r x^{16-3r}

For the constant term, set 163r=016 - 3r = 0, giving r=163r = \frac{16}{3}. Since rr must be a non-negative integer, there is no constant term.

(If the power had been 99, we would get r=183=6r = \frac{18}{3} = 6, and the constant term would be (96)26=8464=5376\binom{9}{6} 2^6 = 84 \cdot 64 = 5376.)

Details

Example 2: Specific power of xx Find the coefficient of x5x^5 in the expansion of (1+2x)12(1 + 2x)^{12}.

The general term is Tr+1=(12r)(2x)r=(12r)2rxrT_{r+1} = \binom{12}{r}(2x)^r = \binom{12}{r} 2^r x^r.

Set r=5r = 5:

Coefficient=(125)25=79232=25344\mathrm{Coefficient} = \binom{12}{5} 2^5 = 792 \cdot 32 = 25344

Details

Example 3: Non-integer power Find the coefficient of x3x^3 in the expansion of (13x)1/2(1 - 3x)^{-1/2} up to x3x^3.

The general term is:

Tr+1=(1/2r)(3x)rT_{r+1} = \binom{-1/2}{r}(-3x)^r

For r=3r = 3:

(1/23)=(1/2)(3/2)(5/2)3!=15/86=516\binom{-1/2}{3} = \frac{(-1/2)(-3/2)(-5/2)}{3!} = \frac{-15/8}{6} = -\frac{5}{16}

T4=(516)(3x)3=(516)(27x3)=13516x3T_4 = \left(-\frac{5}{16}\right)(-3x)^3 = \left(-\frac{5}{16}\right)(-27x^3) = \frac{135}{16}x^3

Coefficient of x3x^3: 13516\frac{135}{16}.


6. Binomial Approximation and Error Estimation

6.1 Using Partial Sums for Approximation

When (1+x)n(1 + x)^n is expanded as an infinite series, taking only the first k+1k + 1 terms gives an approximation. The accuracy depends on how many terms are taken and how small x|x| is.

For small x|x|, the series converges rapidly, so few terms are needed for high accuracy.

6.2 Error Bounds

Theorem (Error bound for alternating decreasing series). If the terms of (1+x)n(1+x)^n are alternating in sign and decreasing in magnitude, then the error when truncating after kk terms is bounded by the magnitude of the next (first omitted) term:

(1+x)nSkTk+1\left|(1+x)^n - S_k\right| \leq |T_{k+1}|

where SkS_k is the partial sum up to and including the xkx^k term, and Tk+1T_{k+1} is the (k+1)(k+1)th term.

This applies when n<0n \lt 0 and x>0x \gt 0, or when nn is fractional with alternating signs.

Details

Example: Approximating 283\sqrt[3]{28} We write 28=27+1=27(1+1/27)28 = 27 + 1 = 27(1 + 1/27), so:

283=(27(1+127))1/3=3(1+127)1/3\sqrt[3]{28} = \left(27\left(1 + \frac{1}{27}\right)\right)^{1/3} = 3\left(1 + \frac{1}{27}\right)^{1/3}

Expanding with n=1/3n = 1/3 and x=1/27x = 1/27:

(1+127)1/3=1+13127+LB13(23)RB◆◆LB2!RB1729+LB13(23)(53)RB◆◆LB3!RB119683+=1+18116561+51594323+1+0.0123460.000152+0.000003+1.012197\begin{aligned} \left(1 + \frac{1}{27}\right)^{1/3} &= 1 + \frac{1}{3}\cdot\frac{1}{27} + \frac◆LB◆\frac{1}{3}\cdot\left(-\frac{2}{3}\right)◆RB◆◆LB◆2!◆RB◆\cdot\frac{1}{729} + \frac◆LB◆\frac{1}{3}\cdot\left(-\frac{2}{3}\right)\cdot\left(-\frac{5}{3}\right)◆RB◆◆LB◆3!◆RB◆\cdot\frac{1}{19683} + \cdots \\ &= 1 + \frac{1}{81} - \frac{1}{6561} + \frac{5}{1594323} + \cdots \\ &\approx 1 + 0.012346 - 0.000152 + 0.000003 + \cdots \\ &\approx 1.012197 \end{aligned}

So 2833×1.012197=3.036591\sqrt[3]{28} \approx 3 \times 1.012197 = 3.036591.

Error estimation. The terms alternate and decrease in magnitude. The next term (the x4x^4 term) has magnitude:

LB13(23)(53)(83)RB◆◆LB4!RB1274=LB80RB◆◆LB243531441RB6.2×107\left|\frac◆LB◆\frac{1}{3}\cdot\left(-\frac{2}{3}\right)\cdot\left(-\frac{5}{3}\right)\cdot\left(-\frac{8}{3}\right)◆RB◆◆LB◆4!◆RB◆\cdot\frac{1}{27^4}\right| = \frac◆LB◆80◆RB◆◆LB◆243 \cdot 531441◆RB◆ \approx 6.2 \times 10^{-7}

So the error in the expansion of (1+1/27)1/3(1 + 1/27)^{1/3} is at most 6.2×107\approx 6.2 \times 10^{-7}, and the error in 283\sqrt[3]{28} is at most 3×6.2×1071.9×1063 \times 6.2 \times 10^{-7} \approx 1.9 \times 10^{-6}.


7. Relationships Between Binomial Coefficients

7.1 Sum of Binomial Coefficients

We already know (from Problem 7 below) that:

r=0n(nr)=2n\sum_{r=0}^{n} \binom{n}{r} = 2^n

This follows from setting a=1a = 1, b=1b = 1 in the binomial theorem.

7.2 Weighted Sum: r(nr)=n2n1\sum r\binom{n}{r} = n \cdot 2^{n-1}

Theorem. r=0nr(nr)=n2n1\displaystyle\sum_{r=0}^{n} r\binom{n}{r} = n \cdot 2^{n-1}.

Proof (using differentiation).

Start with (1+x)n=r=0n(nr)xr(1 + x)^n = \sum_{r=0}^{n} \binom{n}{r} x^r.

Differentiate both sides with respect to xx:

n(1+x)n1=r=0nr(nr)xr1n(1 + x)^{n-1} = \sum_{r=0}^{n} r\binom{n}{r} x^{r-1}

Multiply through by xx:

nx(1+x)n1=r=0nr(nr)xrnx(1 + x)^{n-1} = \sum_{r=0}^{n} r\binom{n}{r} x^r

Set x=1x = 1:

n12n1=r=0nr(nr)n \cdot 1 \cdot 2^{n-1} = \sum_{r=0}^{n} r\binom{n}{r}

Therefore r=0nr(nr)=n2n1\sum_{r=0}^{n} r\binom{n}{r} = n \cdot 2^{n-1}. \blacksquare

Intuition. If you want to select a committee of any size from nn people and then choose a chairperson, you can first pick rr members ((nr)\binom{n}{r} ways) and then a chair from those rr (rr ways). Summing over all rr gives r(nr)\sum r\binom{n}{r}. Alternatively, pick the chair first (nn ways) and then any subset of the remaining n1n - 1 people (2n12^{n-1} ways), giving n2n1n \cdot 2^{n-1}.

7.3 Sum of Squares: r2(nr)=n(n+1)2n2\sum r^2\binom{n}{r} = n(n+1)2^{n-2}

Theorem. r=0nr2(nr)=n(n+1)2n2\displaystyle\sum_{r=0}^{n} r^2\binom{n}{r} = n(n+1) \cdot 2^{n-2}.

Proof (using differentiation).

We have nx(1+x)n1=r=0nr(nr)xrnx(1+x)^{n-1} = \sum_{r=0}^{n} r\binom{n}{r} x^r.

Differentiate both sides with respect to xx:

n(1+x)n1+n(n1)x(1+x)n2=r=0nr2(nr)xr1n(1+x)^{n-1} + n(n-1)x(1+x)^{n-2} = \sum_{r=0}^{n} r^2\binom{n}{r} x^{r-1}

Multiply through by xx:

nx(1+x)n1+n(n1)x2(1+x)n2=r=0nr2(nr)xrnx(1+x)^{n-1} + n(n-1)x^2(1+x)^{n-2} = \sum_{r=0}^{n} r^2\binom{n}{r} x^r

Set x=1x = 1:

n2n1+n(n1)2n2=r=0nr2(nr)n \cdot 2^{n-1} + n(n-1) \cdot 2^{n-2} = \sum_{r=0}^{n} r^2\binom{n}{r}

Factor out n2n2n \cdot 2^{n-2}:

n2n2(2+n1)=n(n+1)2n2=r=0nr2(nr)n \cdot 2^{n-2}(2 + n - 1) = n(n+1) \cdot 2^{n-2} = \sum_{r=0}^{n} r^2\binom{n}{r} \quad \blacksquare

7.4 Vandermonde's Identity

Theorem (Vandermonde's Identity). For non-negative integers n,r,mn, r, m:

k=0m(rk)(nrmk)=(nm)\sum_{k=0}^{m} \binom{r}{k}\binom{n - r}{m - k} = \binom{n}{m}

Proof (combinatorial).

Consider a set of nn people, of which rr are women and nrn - r are men. The right-hand side (nm)\binom{n}{m} counts the number of ways to choose a committee of mm people from all nn.

Alternatively, we can count by cases: choose kk women and mkm - k men. The number of ways to choose kk women is (rk)\binom{r}{k}, and the number of ways to choose mkm - k men is (nrmk)\binom{n-r}{m-k}. Summing over all valid kk gives the left-hand side. \blacksquare


8. Validity of General Binomial Expansion

8.1 Single Expansion Validity

When expanding (a+bx)n(a + bx)^n with non-integer nn, we write it as an(1+bxa)na^n\left(1 + \frac{bx}{a}\right)^n. The expansion is valid when:

bxa<1i.e.,x<ab\left|\frac{bx}{a}\right| \lt 1 \quad \mathrm{i.e.,} \quad |x| \lt \left|\frac{a}{b}\right|

warning

Always state the range of validity when working with non-integer powers. Marks are routinely deducted for omitting this.

8.2 Product of Two Expansions

When a question asks for the expansion of a product of two binomial expressions, such as (1+px)a(1+qx)b(1 + px)^a(1 + qx)^b, each factor has its own validity range:

px<1andqx<1|px| \lt 1 \quad \mathrm{and} \quad |qx| \lt 1

The combined expansion is valid only where both individual expansions are valid. This means the overall validity is the intersection of the two ranges, which is always the more restrictive condition:

x<min(LB1RB◆◆LBpRB,LB1RB◆◆LBqRB)|x| \lt \min\left(\frac◆LB◆1◆RB◆◆LB◆|p|◆RB◆, \frac◆LB◆1◆RB◆◆LB◆|q|◆RB◆\right)

Why? The product expansion is obtained by multiplying the individual series term by term. If either series diverges, the term-by-term multiplication is not justified, so the product expansion may not equal the original expression.

8.3 More Complex Cases

For expressions involving three or more factors, the validity is the intersection of all individual validity ranges.

For partial fraction decompositions that lead to sums of binomial expansions, the same principle applies: the overall validity is the most restrictive individual condition.

Details

Example 1 Find the expansion of (1+x)2(13x)1(1 + x)^{-2}(1 - 3x)^{-1} up to x2x^2, stating the validity.

(1+x)2(1 + x)^{-2}: valid for x<1|x| \lt 1.

(13x)1(1 - 3x)^{-1}: valid for 3x<1|3x| \lt 1, i.e., x<13|x| \lt \frac{1}{3}.

The combined validity is x<13|x| \lt \frac{1}{3} (the more restrictive condition).

(1+x)2=12x+3x2+(1 + x)^{-2} = 1 - 2x + 3x^2 + \cdots

(13x)1=1+3x+9x2+(1 - 3x)^{-1} = 1 + 3x + 9x^2 + \cdots

Product up to x2x^2:

(1)(1)+[(2)(1)+(1)(3)]x+[(3)(1)+(2)(3)+(1)(9)]x2(1)(1) + [(-2)(1) + (1)(3)]x + [(3)(1) + (-2)(3) + (1)(9)]x^2

=1+x+(36+9)x2=1+x+6x2+= 1 + x + (3 - 6 + 9)x^2 = 1 + x + 6x^2 + \cdots

Details

Example 2 Expand 3(1x)(2+x)\frac{3}{(1-x)(2+x)} in ascending powers of xx up to x2x^2.

Partial fractions: 3(1x)(2+x)=A1x+B2+x\frac{3}{(1-x)(2+x)} = \frac{A}{1-x} + \frac{B}{2+x}.

3=A(2+x)+B(1x)3 = A(2 + x) + B(1 - x)

Setting x=1x = 1: 3=3A    A=13 = 3A \implies A = 1. Setting x=2x = -2: 3=3B    B=13 = 3B \implies B = 1.

3(1x)(2+x)=11x+12+x=(1x)1+12(1+x/2)1\frac{3}{(1-x)(2+x)} = \frac{1}{1-x} + \frac{1}{2+x} = (1-x)^{-1} + \frac{1}{2}(1 + x/2)^{-1}

(1x)1(1-x)^{-1}: valid for x<1|x| \lt 1.

(1+x/2)1(1 + x/2)^{-1}: valid for x/2<1|x/2| \lt 1, i.e., x<2|x| \lt 2.

Combined validity: x<1|x| \lt 1.

(1x)1=1+x+x2+(1-x)^{-1} = 1 + x + x^2 + \cdots

12(1+x2)1=12(1x2+x24)=12x4+x28\frac{1}{2}\left(1 + \frac{x}{2}\right)^{-1} = \frac{1}{2}\left(1 - \frac{x}{2} + \frac{x^2}{4} - \cdots\right) = \frac{1}{2} - \frac{x}{4} + \frac{x^2}{8} - \cdots

3(1x)(2+x)=32+34x+98x2+\frac{3}{(1-x)(2+x)} = \frac{3}{2} + \frac{3}{4}x + \frac{9}{8}x^2 + \cdots


9. Problem Set

Problem 1. Expand (1+3x)4(1 + 3x)^4.

Details

Solution (1+3x)4=(40)+(41)(3x)+(42)(3x)2+(43)(3x)3+(44)(3x)4(1 + 3x)^4 = \binom{4}{0} + \binom{4}{1}(3x) + \binom{4}{2}(3x)^2 + \binom{4}{3}(3x)^3 + \binom{4}{4}(3x)^4

=1+12x+54x2+108x3+81x4= 1 + 12x + 54x^2 + 108x^3 + 81x^4

If you get this wrong, revise: Binomial theorem


Problem 2. Find the coefficient of x3x^3 in the expansion of (2x)6(2 - x)^6.

Details

Solution The x3x^3 term comes from r=3r = 3:

(63)(2)63(x)3=208(x3)=160x3\binom{6}{3}(2)^{6-3}(-x)^3 = 20 \cdot 8 \cdot (-x^3) = -160x^3

Coefficient of x3x^3: 160-160.

If you get this wrong, revise: Binomial theorem


Problem 3. Expand (1+x)2(1 + x)^{-2} up to the term in x3x^3, stating the range of validity.

Solution
(1+x)2=1+(2)x+(2)(3)2!x2+(2)(3)(4)3!x3+=12x+3x24x3+\begin{aligned} (1 + x)^{-2} &= 1 + (-2)x + \frac{(-2)(-3)}{2!}x^2 + \frac{(-2)(-3)(-4)}{3!}x^3 + \cdots \\ &= 1 - 2x + 3x^2 - 4x^3 + \cdots \end{aligned}

Valid for x<1|x| \lt 1.

If you get this wrong, revise: General binomial expansion


Problem 4. Find the coefficient of x2x^2 in the expansion of (12x)5(1+3x)4(1 - 2x)^5(1 + 3x)^4.

Details

Solution (12x)5=110x+40x2+(1 - 2x)^5 = 1 - 10x + 40x^2 + \cdots

(1+3x)4=1+12x+54x2+(1 + 3x)^4 = 1 + 12x + 54x^2 + \cdots

Coefficient of x2x^2 in the product:

  • From (1)(54x2)(1)(54x^2): 5454
  • From (10x)(12x)(-10x)(12x): 120-120
  • From (40x2)(1)(40x^2)(1): 4040

Total: 54120+40=2654 - 120 + 40 = -26.

If you get this wrong, revise: Binomial theorem


Problem 5. Use the binomial expansion to estimate 1.05\sqrt{1.05} to 5 decimal places.

Details

Solution 1.05=(1+0.05)1/2\sqrt{1.05} = (1 + 0.05)^{1/2}

=1+12(0.05)+LB12(12)RB◆◆LB2RB(0.05)2+LB12(12)(32)RB◆◆LB6RB(0.05)3+= 1 + \frac{1}{2}(0.05) + \frac◆LB◆\frac{1}{2} \cdot \left(-\frac{1}{2}\right)◆RB◆◆LB◆2◆RB◆(0.05)^2 + \frac◆LB◆\frac{1}{2}\left(-\frac{1}{2}\right)\left(-\frac{3}{2}\right)◆RB◆◆LB◆6◆RB◆(0.05)^3 + \cdots

=1+0.0250.0003125+0.0000078125= 1 + 0.025 - 0.0003125 + 0.0000078125 - \cdots

1.024695\approx 1.024695

To 5 d.p.: 1.024701.02470.

If you get this wrong, revise: General binomial expansion


Problem 6. In the expansion of (1+ax)n(1 + ax)^n, the coefficients of xx, x2x^2, and x3x^3 are in the ratio 1:4:121 : 4 : 12. Find aa and nn.

Details

Solution Coefficient of xx: nana

Coefficient of x2x^2: n(n1)2a2\frac{n(n-1)}{2}a^2

Coefficient of x3x^3: n(n1)(n2)6a3\frac{n(n-1)(n-2)}{6}a^3

Ratio 1:4:121 : 4 : 12:

n(n1)2a2=4na    (n1)a2=4    (n1)a=8(1)\frac{n(n-1)}{2}a^2 = 4na \implies \frac{(n-1)a}{2} = 4 \implies (n-1)a = 8 \quad \mathrm{--- (1)}

n(n1)(n2)6a3=12na    (n1)(n2)a26=12(2)\frac{n(n-1)(n-2)}{6}a^3 = 12na \implies \frac{(n-1)(n-2)a^2}{6} = 12 \quad \mathrm{--- (2)}

From (1): a=8n1a = \frac{8}{n-1}. Substitute into (2):

(n1)(n2)664(n1)2=12\frac{(n-1)(n-2)}{6} \cdot \frac{64}{(n-1)^2} = 12

64(n2)6(n1)=12\frac{64(n-2)}{6(n-1)} = 12

64(n2)=72(n1)64(n-2) = 72(n-1)

64n128=72n7264n - 128 = 72n - 72

8n=56    n=7-8n = 56 \implies n = -7

a=88=1a = \frac{8}{-8} = -1.

If you get this wrong, revise: General binomial expansion


Problem 7. Prove that r=0n(nr)=2n\sum_{r=0}^{n} \binom{n}{r} = 2^n.

Details

Solution Setting a=1a = 1 and b=1b = 1 in the binomial theorem:

(1+1)n=r=0n(nr)1nr1r=r=0n(nr)(1 + 1)^n = \sum_{r=0}^{n} \binom{n}{r} 1^{n-r} 1^r = \sum_{r=0}^{n} \binom{n}{r}

So r=0n(nr)=2n\sum_{r=0}^{n} \binom{n}{r} = 2^n. \blacksquare

Intuition. The sum of all binomial coefficients counts the total number of subsets of an nn-element set, which is 2n2^n (each element can either be included or excluded).

If you get this wrong, revise: Binomial coefficients


Problem 8. Expand 1(1+x)(12x)\frac{1}{(1 + x)(1 - 2x)} in ascending powers of xx up to x3x^3, stating the range of validity.

Details

Solution Using partial fractions: 1(1+x)(12x)=1311+x+23112x\frac{1}{(1+x)(1-2x)} = \frac{1}{3}\cdot\frac{1}{1+x} + \frac{2}{3}\cdot\frac{1}{1-2x}.

11+x=(1+x)1=1x+x2x3+(x<1)\frac{1}{1+x} = (1+x)^{-1} = 1 - x + x^2 - x^3 + \cdots \quad (|x| \lt 1)

112x=(12x)1=1+2x+4x2+8x3+(2x<1)\frac{1}{1-2x} = (1-2x)^{-1} = 1 + 2x + 4x^2 + 8x^3 + \cdots \quad (|2x| \lt 1)

1(1+x)(12x)=13(1x+x2x3)+23(1+2x+4x2+8x3)+=13+23+(13+43)x+(13+83)x2+(13+163)x3+=1+x+3x2+5x3+\begin{aligned} \frac{1}{(1+x)(1-2x)} &= \frac{1}{3}(1 - x + x^2 - x^3) + \frac{2}{3}(1 + 2x + 4x^2 + 8x^3) + \cdots \\ &= \frac{1}{3} + \frac{2}{3} + \left(-\frac{1}{3} + \frac{4}{3}\right)x + \left(\frac{1}{3} + \frac{8}{3}\right)x^2 + \left(-\frac{1}{3} + \frac{16}{3}\right)x^3 + \cdots \\ &= 1 + x + 3x^2 + 5x^3 + \cdots \end{aligned}

Valid for x<12|x| \lt \frac{1}{2} (the more restrictive condition).

If you get this wrong, revise: General binomial expansion


Problem 9. Given that the expansion of (1+kx)10(1 + kx)^{10} in ascending powers of xx has a coefficient of x3x^3 equal to 10801080, find the value of kk.

Details

Solution (103)k3=1080\binom{10}{3} k^3 = 1080

120k3=1080120k^3 = 1080

k3=9k^3 = 9

k=93k = \sqrt[3]{9}

If you get this wrong, revise: Binomial theorem


Problem 10. Prove that r=0n(1)r(nr)=0\sum_{r=0}^{n} (-1)^r \binom{n}{r} = 0 for n1n \geq 1.

Details

Solution Setting a=1a = 1 and b=1b = -1 in the binomial theorem:

(11)n=r=0n(nr)1nr(1)r=r=0n(1)r(nr)(1 - 1)^n = \sum_{r=0}^{n} \binom{n}{r} 1^{n-r}(-1)^r = \sum_{r=0}^{n} (-1)^r \binom{n}{r}

0n=00^n = 0 for n1n \geq 1. \blacksquare

Intuition. This counts the difference between subsets of even size and subsets of odd size — which is zero by a parity argument (there's a bijection between even-sized and odd-sized subsets: add or remove one element).

If you get this wrong, revise: Binomial coefficients


Problem 11. Find the coefficient of x3x^3 in the expansion of (1+x)3(12x)1(1 + x)^{-3}(1 - 2x)^{-1} up to x3x^3, stating the range of validity.

Details

Solution First expand each factor:

(1+x)3=1+(3)x+(3)(4)2x2+(3)(4)(5)6x3+=13x+6x210x3+(1 + x)^{-3} = 1 + (-3)x + \frac{(-3)(-4)}{2}x^2 + \frac{(-3)(-4)(-5)}{6}x^3 + \cdots = 1 - 3x + 6x^2 - 10x^3 + \cdots

(12x)1=1+2x+4x2+8x3+(1 - 2x)^{-1} = 1 + 2x + 4x^2 + 8x^3 + \cdots

Coefficient of x3x^3 in the product:

  • From (1)(8x3)(1)(8x^3): 88
  • From (3x)(4x2)(-3x)(4x^2): 12-12
  • From (6x2)(2x)(6x^2)(2x): 1212
  • From (10x3)(1)(-10x^3)(1): 10-10

Total: 812+1210=28 - 12 + 12 - 10 = -2.

Validity: (1+x)3(1+x)^{-3} requires x<1|x| \lt 1 and (12x)1(1-2x)^{-1} requires x<1/2|x| \lt 1/2. Overall: x<1/2|x| \lt 1/2.

If you get this wrong, revise: Validity of general binomial expansion


Problem 12. Use the binomial expansion to approximate 1263\sqrt[3]{126} to 4 decimal places. Estimate the error in your approximation.

Details

Solution Write 126=125+1=125(1+1/125)126 = 125 + 1 = 125(1 + 1/125):

1263=5(1+1125)1/3\sqrt[3]{126} = 5\left(1 + \frac{1}{125}\right)^{1/3}

Expand with n=1/3n = 1/3, x=1/125=0.008x = 1/125 = 0.008:

(1+1125)1/3=1+131125+LB13(23)RB◆◆LB2RB115625+=1+1375170312.5+1+0.00266670.0000142+1.0026525\begin{aligned} \left(1 + \frac{1}{125}\right)^{1/3} &= 1 + \frac{1}{3}\cdot\frac{1}{125} + \frac◆LB◆\frac{1}{3}\cdot\left(-\frac{2}{3}\right)◆RB◆◆LB◆2◆RB◆\cdot\frac{1}{15625} + \cdots \\ &= 1 + \frac{1}{375} - \frac{1}{70312.5} + \cdots \\ &\approx 1 + 0.0026667 - 0.0000142 + \cdots \\ &\approx 1.0026525 \end{aligned}

12635×1.0026525=5.01326\sqrt[3]{126} \approx 5 \times 1.0026525 = 5.01326

To 4 d.p.: 5.01335.0133.

Error estimate. The terms alternate and decrease. The next term (the x3x^3 term) has magnitude:

LB13(23)(53)RB◆◆LB6RB11253=10/1626119531255.3×109\left|\frac◆LB◆\frac{1}{3}\cdot\left(-\frac{2}{3}\right)\cdot\left(-\frac{5}{3}\right)◆RB◆◆LB◆6◆RB◆\cdot\frac{1}{125^3}\right| = \frac{10/162}{6} \cdot \frac{1}{1953125} \approx 5.3 \times 10^{-9}

The error in 1263\sqrt[3]{126} is at most 5×5.3×1092.7×1085 \times 5.3 \times 10^{-9} \approx 2.7 \times 10^{-8}, which is negligible for 4 decimal places. The approximation 5.01335.0133 is reliable.

If you get this wrong, revise: Binomial approximation and error estimation


Problem 13. Evaluate r=010r(10r)\sum_{r=0}^{10} r\binom{10}{r}.

Details

Solution By the identity r=0nr(nr)=n2n1\sum_{r=0}^{n} r\binom{n}{r} = n \cdot 2^{n-1} with n=10n = 10:

r=010r(10r)=1029=10×512=5120\sum_{r=0}^{10} r\binom{10}{r} = 10 \cdot 2^{9} = 10 \times 512 = 5120

Verification by differentiation:

(1+x)10=r=010(10r)xr(1+x)^{10} = \sum_{r=0}^{10} \binom{10}{r} x^r. Differentiate and set x=1x = 1:

10(1+1)9=r=010r(10r)=10×512=512010(1+1)^9 = \sum_{r=0}^{10} r\binom{10}{r} = 10 \times 512 = 5120

If you get this wrong, revise: Relationships between binomial coefficients


Problem 14. In the expansion of (2+3x)2n(2 + 3x)^{2n}, the ratio of the coefficient of x3x^3 to the coefficient of xx is 11:111 : 1. Find the value of nn.

Details

Solution The general term in the expansion of (2+3x)2n(2 + 3x)^{2n} is (2nr)22nr(3x)r\binom{2n}{r} 2^{2n-r}(3x)^r.

Coefficient of xx: (2n1)22n13=2n22n13=3n22n\binom{2n}{1} 2^{2n-1} \cdot 3 = 2n \cdot 2^{2n-1} \cdot 3 = 3n \cdot 2^{2n}.

Coefficient of x3x^3: (2n3)22n327=2n(2n1)(2n2)62722n3\binom{2n}{3} 2^{2n-3} \cdot 27 = \frac{2n(2n-1)(2n-2)}{6} \cdot 27 \cdot 2^{2n-3}.

Ratio is 11:111 : 1:

LB2n(2n1)(2n2)62722n3RB◆◆LB3n22nRB=11\frac◆LB◆\displaystyle \frac{2n(2n-1)(2n-2)}{6} \cdot 27 \cdot 2^{2n-3}◆RB◆◆LB◆3n \cdot 2^{2n}◆RB◆ = 11

Simplify:

LB2n(2n1)(2n2)2722n3RB◆◆LB63n22nRB=11\frac◆LB◆2n(2n-1)(2n-2) \cdot 27 \cdot 2^{2n-3}◆RB◆◆LB◆6 \cdot 3n \cdot 2^{2n}◆RB◆ = 11

LB2n(2n1)(2n2)922n3RB◆◆LB6n22nRB=11\frac◆LB◆2n(2n-1)(2n-2) \cdot 9 \cdot 2^{2n-3}◆RB◆◆LB◆6n \cdot 2^{2n}◆RB◆ = 11

LB(2n1)(2n2)1822n3RB◆◆LB622nRB=11\frac◆LB◆(2n-1)(2n-2) \cdot 18 \cdot 2^{2n-3}◆RB◆◆LB◆6 \cdot 2^{2n}◆RB◆ = 11

LB(2n1)(2n2)18RB◆◆LB68RB=11\frac◆LB◆(2n-1)(2n-2) \cdot 18◆RB◆◆LB◆6 \cdot 8◆RB◆ = 11

LB(2n1)(2n2)3RB◆◆LB8RB=11\frac◆LB◆(2n-1)(2n-2) \cdot 3◆RB◆◆LB◆8◆RB◆ = 11

(2n1)(2n2)=883(2n-1)(2n-2) = \frac{88}{3}

This gives a non-integer, so let us recheck. We need nn such that the ratio equals 1111. Trying small values:

n=3n = 3: coefficient of x3x^3 is (63)2327=20827=4320\binom{6}{3} 2^3 \cdot 27 = 20 \cdot 8 \cdot 27 = 4320. Coefficient of xx is 6323=5766 \cdot 32 \cdot 3 = 576. Ratio: 4320/576=7.54320/576 = 7.5.

n=4n = 4: coefficient of x3x^3 is (83)2527=563227=48384\binom{8}{3} 2^5 \cdot 27 = 56 \cdot 32 \cdot 27 = 48384. Coefficient of xx is 81283=30728 \cdot 128 \cdot 3 = 3072. Ratio: 48384/307215.7548384/3072 \approx 15.75.

n=5n = 5: coefficient of x3x^3 is (103)2727=12012827=414720\binom{10}{3} 2^7 \cdot 27 = 120 \cdot 128 \cdot 27 = 414720. Coefficient of xx is 105123=1536010 \cdot 512 \cdot 3 = 15360. Ratio: 414720/15360=27414720/15360 = 27.

Since 7.5<11<15.757.5 \lt 11 \lt 15.75 and the ratio is increasing, there is no integer nn giving ratio exactly 1111. However, solving the equation more carefully:

(2n1)(2n2)4=11\frac{(2n-1)(2n-2)}{4} = 11

2(2n1)(n1)=112(2n-1)(n-1) = 11

(2n1)(n1)=112(2n-1)(n-1) = \frac{11}{2}

2n23n+1=1122n^2 - 3n + 1 = \frac{11}{2}

4n26n9=04n^2 - 6n - 9 = 0

n=LB6±36+144RB◆◆LB8RB=LB6±180RB◆◆LB8RB=LB6±65RB◆◆LB8RB=LB3±35RB◆◆LB4RBn = \frac◆LB◆6 \pm \sqrt{36 + 144}◆RB◆◆LB◆8◆RB◆ = \frac◆LB◆6 \pm \sqrt{180}◆RB◆◆LB◆8◆RB◆ = \frac◆LB◆6 \pm 6\sqrt{5}◆RB◆◆LB◆8◆RB◆ = \frac◆LB◆3 \pm 3\sqrt{5}◆RB◆◆LB◆4◆RB◆

Since nn must be a positive integer, there is no integer solution. The ratio 11:111 : 1 cannot be achieved for any positive integer nn with (2+3x)2n(2+3x)^{2n}.

(The closest integer value is n=4n = 4 giving ratio 15.75\approx 15.75, and n=3n = 3 giving 7.57.5.)

If you get this wrong, revise: Finding specific terms


Problem 15. Expand 2(1+x)2(12x)\frac{2}{(1+x)^2(1-2x)} in ascending powers of xx up to x2x^2, stating the range of validity.

Details

Solution First, find partial fractions. Write:

2(1+x)2(12x)=A1+x+B(1+x)2+C12x\frac{2}{(1+x)^2(1-2x)} = \frac{A}{1+x} + \frac{B}{(1+x)^2} + \frac{C}{1-2x}

2=A(1+x)(12x)+B(12x)+C(1+x)22 = A(1+x)(1-2x) + B(1-2x) + C(1+x)^2

Setting x=2x = -2: 2=C(1)2=C2 = C(-1)^2 = C, so C=2C = 2.

Setting x=1x = -1: 2=B(3)2 = B(3), so B=23B = \frac{2}{3}.

Setting x=0x = 0: 2=A+B+C=A+2/3+22 = A + B + C = A + 2/3 + 2, so A=28/3=2/3A = 2 - 8/3 = -2/3.

So:

2(1+x)2(12x)=23(1+x)1+23(1+x)2+2(12x)1\frac{2}{(1+x)^2(1-2x)} = -\frac{2}{3}(1+x)^{-1} + \frac{2}{3}(1+x)^{-2} + 2(1-2x)^{-1}

Now expand each:

(1+x)1=1x+x2+(x<1)(1+x)^{-1} = 1 - x + x^2 + \cdots \quad (|x| \lt 1)

(1+x)2=12x+3x2+(x<1)(1+x)^{-2} = 1 - 2x + 3x^2 + \cdots \quad (|x| \lt 1)

(12x)1=1+2x+4x2+(x<1/2)(1-2x)^{-1} = 1 + 2x + 4x^2 + \cdots \quad (|x| \lt 1/2)

2(1+x)2(12x)=23(1x+x2)+23(12x+3x2)+2(1+2x+4x2)+=(23+23+2)+(2343+4)x+(23+2+8)x2+=2+103x+283x2+\begin{aligned} \frac{2}{(1+x)^2(1-2x)} &= -\frac{2}{3}(1 - x + x^2) + \frac{2}{3}(1 - 2x + 3x^2) + 2(1 + 2x + 4x^2) + \cdots \\ &= \left(-\frac{2}{3} + \frac{2}{3} + 2\right) + \left(\frac{2}{3} - \frac{4}{3} + 4\right)x + \left(-\frac{2}{3} + 2 + 8\right)x^2 + \cdots \\ &= 2 + \frac{10}{3}x + \frac{28}{3}x^2 + \cdots \end{aligned}

Validity: the most restrictive condition is x<1/2|x| \lt 1/2 (from (12x)1(1-2x)^{-1}).

If you get this wrong, revise: Validity of general binomial expansion


tip

tip Ready to test your understanding of Binomial Expansion? The diagnostic test contains the hardest questions within the A-Level specification for this topic, each with a full worked solution.

Unit tests probe edge cases and common misconceptions. Integration tests combine Binomial Expansion with other pure mathematics topics to test synthesis under exam conditions.

See Diagnostic Guide for instructions on self-marking and building a personal test matrix.