Skip to main content

Trigonometry

Board Coverage

BoardPaperNotes
AQAPaper 1, 2Basic trig in P1; compound/double angle, trig equations in P2
EdexcelP1, P2Similar split
OCR (A)Paper 1, 2Includes small angle approximations
CIE (9709)P1, P2, P3Trig functions in P1; identities and equations in P2; further trig in P3
info

All boards provide trigonometric identities in the formula booklet, but not their proofs. You need to know which identities exist and how to apply them.


1. The Unit Circle Definitions

Definition. Consider the unit circle (radius 1, centre at the origin). For an angle θ\theta measured anticlockwise from the positive xx-axis, the point on the circle is (cosθ,sinθ)(\cos\theta, \sin\theta).

Definition.

cosθ=thexcoordinateofthepointontheunitcircleatangleθ\cos\theta = \mathrm{the } x\mathrm{-coordinate of the point on the unit circle at angle } \theta

sinθ=theycoordinateofthepointontheunitcircleatangleθ\sin\theta = \mathrm{the } y\mathrm{-coordinate of the point on the unit circle at angle } \theta

tanθ=LBsinθRB◆◆LBcosθRB(cosθ0)\tan\theta = \frac◆LB◆\sin\theta◆RB◆◆LB◆\cos\theta◆RB◆ \quad (\cos\theta \neq 0)

Intuition. These definitions extend the right-triangle definitions (SOH CAH TOA) to all angles, not just those between 0° and 90°. The unit circle makes clear why sin\sin and cos\cos are periodic with period 2π2\pi.

1.1 Radian Measure

Definition. One radian is the angle subtended at the centre of a circle by an arc equal in length to the radius.

θ(radians)=LBarclengthRB◆◆LBrRB\theta\mathrm{ (radians)} = \frac◆LB◆\mathrm{arc length}◆RB◆◆LB◆r◆RB◆

The full circle: 2π2\pi radians =360= 360^\circ, so π\pi radians =180= 180^\circ.

Theorem (Arc length and sector area). For a sector of radius rr and angle θ\theta (in radians):

Arclengths=rθ\mathrm{Arc length } s = r\theta

SectorareaA=12r2θ\mathrm{Sector area } A = \frac{1}{2}r^2\theta

Proof. By definition, θ=s/r\theta = s/r, so s=rθs = r\theta. The sector is a fraction LBθRB◆◆LB2πRB\frac◆LB◆\theta◆RB◆◆LB◆2\pi◆RB◆ of the full circle (area πr2\pi r^2), so A=LBθRB◆◆LB2πRBπr2=12r2θA = \frac◆LB◆\theta◆RB◆◆LB◆2\pi◆RB◆ \cdot \pi r^2 = \frac{1}{2}r^2\theta. \blacksquare


2. Fundamental Identities

2.1 Pythagorean Identity

Theorem. For all θR\theta \in \mathbb{R}:

sin2θ+cos2θ=1\sin^2\theta + \cos^2\theta = 1

Proof. The point (cosθ,sinθ)(\cos\theta, \sin\theta) lies on the unit circle x2+y2=1x^2 + y^2 = 1.

cos2θ+sin2θ=1\cos^2\theta + \sin^2\theta = 1 \quad \blacksquare

Corollary. Dividing by cos2θ\cos^2\theta (where cosθ0\cos\theta \neq 0):

1+tan2θ=sec2θ1 + \tan^2\theta = \sec^2\theta

Dividing by sin2θ\sin^2\theta (where sinθ0\sin\theta \neq 0):

cot2θ+1=cosec2θ\cot^2\theta + 1 = \cosec^2\theta


3. Compound Angle Formulas

3.1 Sine of a Sum

Theorem. For all A,BRA, B \in \mathbb{R}:

sin(A+B)=sinAcosB+cosAsinB\sin(A + B) = \sin A \cos B + \cos A \sin B

Proof (using rotation matrices). Consider the rotation of the plane by angle AA followed by rotation by angle BB. The combined rotation is by angle A+BA + B.

The rotation matrix by angle θ\theta is:

R(θ)=(cosθsinθsinθcosθ)R(\theta) = \begin{pmatrix} \cos\theta & -\sin\theta \\ \sin\theta & \cos\theta \end{pmatrix}

Matrix multiplication gives: R(A)R(B)=R(A+B)R(A)R(B) = R(A + B).

(cosAsinAsinAcosA)(cosBsinBsinBcosB)=(cos(A+B)sin(A+B)sin(A+B)cos(A+B))\begin{pmatrix} \cos A & -\sin A \\ \sin A & \cos A \end{pmatrix}\begin{pmatrix} \cos B & -\sin B \\ \sin B & \cos B \end{pmatrix} = \begin{pmatrix} \cos(A+B) & -\sin(A+B) \\ \sin(A+B) & \cos(A+B) \end{pmatrix}

The (2,1)(2, 1) entry of the product is:

sinAcosB+cosAsinB=sin(A+B)\sin A \cos B + \cos A \sin B = \sin(A + B) \quad \blacksquare

3.2 Cosine of a Sum

Theorem.

cos(A+B)=cosAcosBsinAsinB\cos(A + B) = \cos A \cos B - \sin A \sin B

Proof. From the (1,1)(1, 1) entry of the matrix product above:

cosAcosBsinAsinB=cos(A+B)\cos A \cos B - \sin A \sin B = \cos(A + B) \quad \blacksquare

3.3 Tangent of a Sum

Theorem.

tan(A+B)=LBtanA+tanBRB◆◆LB1tanAtanBRB\tan(A + B) = \frac◆LB◆\tan A + \tan B◆RB◆◆LB◆1 - \tan A \tan B◆RB◆

Proof.

tan(A+B)=LBsin(A+B)RB◆◆LBcos(A+B)RB=LBsinAcosB+cosAsinBRB◆◆LBcosAcosBsinAsinBRB\begin{aligned} \tan(A + B) &= \frac◆LB◆\sin(A + B)◆RB◆◆LB◆\cos(A + B)◆RB◆ \\ &= \frac◆LB◆\sin A \cos B + \cos A \sin B◆RB◆◆LB◆\cos A \cos B - \sin A \sin B◆RB◆ \end{aligned}

Divide numerator and denominator by cosAcosB\cos A \cos B:

=LBtanA+tanBRB◆◆LB1tanAtanBRB= \frac◆LB◆\tan A + \tan B◆RB◆◆LB◆1 - \tan A \tan B◆RB◆ \quad \blacksquare

3.4 Difference Formulas

Theorem.

sin(AB)=sinAcosBcosAsinBcos(AB)=cosAcosB+sinAsinBtan(AB)=LBtanAtanBRB◆◆LB1+tanAtanBRB\begin{aligned} \sin(A - B) &= \sin A \cos B - \cos A \sin B \\ \cos(A - B) &= \cos A \cos B + \sin A \sin B \\ \tan(A - B) &= \frac◆LB◆\tan A - \tan B◆RB◆◆LB◆1 + \tan A \tan B◆RB◆ \end{aligned}

Proof. Replace BB with B-B in the sum formulas, using sin(B)=sinB\sin(-B) = -\sin B and cos(B)=cosB\cos(-B) = \cos B. \blacksquare


4. Double Angle Formulas

Setting A=BA = B in the compound angle formulas:

sin2A=2sinAcosAcos2A=cos2Asin2Atan2A=LB2tanARB◆◆LB1tan2ARB\begin{aligned} \sin 2A &= 2\sin A \cos A \\ \cos 2A &= \cos^2 A - \sin^2 A \\ \tan 2A &= \frac◆LB◆2\tan A◆RB◆◆LB◆1 - \tan^2 A◆RB◆ \end{aligned}

Theorem. Three equivalent forms of cos2A\cos 2A:

cos2A=cos2Asin2A=2cos2A1=12sin2A\cos 2A = \cos^2 A - \sin^2 A = 2\cos^2 A - 1 = 1 - 2\sin^2 A

Proof. Using sin2A=1cos2A\sin^2 A = 1 - \cos^2 A:

cos2Asin2A=cos2A(1cos2A)=2cos2A1\cos^2 A - \sin^2 A = \cos^2 A - (1 - \cos^2 A) = 2\cos^2 A - 1

Using cos2A=1sin2A\cos^2 A = 1 - \sin^2 A:

cos2Asin2A=(1sin2A)sin2A=12sin2A\cos^2 A - \sin^2 A = (1 - \sin^2 A) - \sin^2 A = 1 - 2\sin^2 A \blacksquare

Intuition. The double angle formulas express functions of 2A2A purely in terms of functions of AA. They are the algebraic backbone of many trigonometric manipulations and are essential for integration.


5. Solving Trigonometric Equations

5.1 Basic Strategy

  1. Use identities to reduce to a single trigonometric function.
  2. Solve the resulting equation.
  3. Find all solutions in the required interval.

5.2 Key Solutions

sinθ=a    θ=arcsin(a)+2nπorπarcsin(a)+2nπcosθ=a    θ=±arccos(a)+2nπtanθ=a    θ=arctan(a)+nπ\begin{aligned} \sin\theta = a &\implies \theta = \arcsin(a) + 2n\pi \mathrm{ or } \pi - \arcsin(a) + 2n\pi \\ \cos\theta = a &\implies \theta = \pm\arccos(a) + 2n\pi \\ \tan\theta = a &\implies \theta = \arctan(a) + n\pi \end{aligned}
Details

Example Solve 2sin2θ+3cosθ3=02\sin^2\theta + 3\cos\theta - 3 = 0 for 0θ<2π0 \leq \theta < 2\pi.

Using sin2θ=1cos2θ\sin^2\theta = 1 - \cos^2\theta:

2(1cos2θ)+3cosθ3=02(1 - \cos^2\theta) + 3\cos\theta - 3 = 0

2cos2θ+3cosθ1=0-2\cos^2\theta + 3\cos\theta - 1 = 0

2cos2θ3cosθ+1=02\cos^2\theta - 3\cos\theta + 1 = 0

(2cosθ1)(cosθ1)=0(2\cos\theta - 1)(\cos\theta - 1) = 0

cosθ=12    θ=LBπRB◆◆LB3RB\cos\theta = \frac{1}{2} \implies \theta = \frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆ or LB5πRB◆◆LB3RB\frac◆LB◆5\pi◆RB◆◆LB◆3◆RB◆.

cosθ=1    θ=0\cos\theta = 1 \implies \theta = 0.

Solutions: θ=0,LBπRB◆◆LB3RB,LB5πRB◆◆LB3RB\theta = 0, \frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆, \frac◆LB◆5\pi◆RB◆◆LB◆3◆RB◆.


6. Small Angle Approximations

Theorem. For small θ\theta (in radians):

sinθθLBθ3RB◆◆LB6RBcosθ1LBθ2RB◆◆LB2RBtanθθ+LBθ3RB◆◆LB3RB\begin{aligned} \sin\theta &\approx \theta - \frac◆LB◆\theta^3◆RB◆◆LB◆6◆RB◆ \\ \cos\theta &\approx 1 - \frac◆LB◆\theta^2◆RB◆◆LB◆2◆RB◆ \\ \tan\theta &\approx \theta + \frac◆LB◆\theta^3◆RB◆◆LB◆3◆RB◆ \end{aligned}

These follow from the Maclaurin series expansions (see Differentiation).

For the linear approximations (when θ\theta is very small):

sinθθ,cosθ1,tanθθ\sin\theta \approx \theta, \quad \cos\theta \approx 1, \quad \tan\theta \approx \theta

Intuition. Near the origin, the curves y=sinθy = \sin\theta and y=tanθy = \tan\theta are almost indistinguishable from the line y=θy = \theta. The curve y=cosθy = \cos\theta is nearly flat at y=1y = 1.

warning

The small angle approximations are only valid when θ\theta is in radians, not degrees. This is a very common exam error.


7. Half-Angle Formulas

Theorem. For all θ\theta:

sinLBθRB◆◆LB2RB=±LBLB1cosθRB◆◆LB2RB◆◆RB\sin\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ = \pm\sqrt◆LB◆\frac◆LB◆1 - \cos\theta◆RB◆◆LB◆2◆RB◆◆RB◆

cosLBθRB◆◆LB2RB=±LBLB1+cosθRB◆◆LB2RB◆◆RB\cos\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ = \pm\sqrt◆LB◆\frac◆LB◆1 + \cos\theta◆RB◆◆LB◆2◆RB◆◆RB◆

tanLBθRB◆◆LB2RB=LBsinθRB◆◆LB1+cosθRB=LB1cosθRB◆◆LBsinθRB\tan\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ = \frac◆LB◆\sin\theta◆RB◆◆LB◆1 + \cos\theta◆RB◆ = \frac◆LB◆1 - \cos\theta◆RB◆◆LB◆\sin\theta◆RB◆

7.1 Derivation

Starting from cos2A=12sin2A\cos 2A = 1 - 2\sin^2 A and substituting A=LBθRB◆◆LB2RBA = \frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆:

cosθ=12sin2LBθRB◆◆LB2RB\cos\theta = 1 - 2\sin^2\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆

2sin2LBθRB◆◆LB2RB=1cosθ2\sin^2\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ = 1 - \cos\theta

sinLBθRB◆◆LB2RB=±LBLB1cosθRB◆◆LB2RB◆◆RB\sin\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ = \pm\sqrt◆LB◆\frac◆LB◆1 - \cos\theta◆RB◆◆LB◆2◆RB◆◆RB◆ \quad \blacksquare

Similarly, from cos2A=2cos2A1\cos 2A = 2\cos^2 A - 1:

cosθ=2cos2LBθRB◆◆LB2RB1\cos\theta = 2\cos^2\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ - 1

2cos2LBθRB◆◆LB2RB=1+cosθ2\cos^2\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ = 1 + \cos\theta

cosLBθRB◆◆LB2RB=±LBLB1+cosθRB◆◆LB2RB◆◆RB\cos\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ = \pm\sqrt◆LB◆\frac◆LB◆1 + \cos\theta◆RB◆◆LB◆2◆RB◆◆RB◆ \quad \blacksquare

7.2 Tangent Half-Angle Formulas

The tangent half-angle formulas avoid the ambiguity of the ±\pm sign:

tanLBθRB◆◆LB2RB=LBsinθRB◆◆LB1+cosθRB\tan\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ = \frac◆LB◆\sin\theta◆RB◆◆LB◆1 + \cos\theta◆RB◆

Proof. Using the double angle formulas:

LBsinθRB◆◆LB1+cosθRB=LB2sinLBθRB◆◆LB2RBcosLBθRB◆◆LB2RB◆◆RB◆◆LB1+(2cos2LBθRB◆◆LB2RB1)RB=LB2sinLBθRB◆◆LB2RBcosLBθRB◆◆LB2RB◆◆RB◆◆LB2cos2LBθRB◆◆LB2RB◆◆RB=LBsinLBθRB◆◆LB2RB◆◆RB◆◆LBcosLBθRB◆◆LB2RB◆◆RB=tanLBθRB◆◆LB2RB\frac◆LB◆\sin\theta◆RB◆◆LB◆1 + \cos\theta◆RB◆ = \frac◆LB◆2\sin\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆\cos\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆◆RB◆◆LB◆1 + (2\cos^2\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ - 1)◆RB◆ = \frac◆LB◆2\sin\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆\cos\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆◆RB◆◆LB◆2\cos^2\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆◆RB◆ = \frac◆LB◆\sin\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆◆RB◆◆LB◆\cos\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆◆RB◆ = \tan\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ \quad \blacksquare

Similarly:

tanLBθRB◆◆LB2RB=LB1cosθRB◆◆LBsinθRB\tan\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ = \frac◆LB◆1 - \cos\theta◆RB◆◆LB◆\sin\theta◆RB◆

Proof. LB1cosθRB◆◆LBsinθRB=LB1(12sin2LBθRB◆◆LB2RB)RB◆◆LB2sinLBθRB◆◆LB2RBcosLBθRB◆◆LB2RB◆◆RB=LB2sin2LBθRB◆◆LB2RB◆◆RB◆◆LB2sinLBθRB◆◆LB2RBcosLBθRB◆◆LB2RB◆◆RB=LBsinLBθRB◆◆LB2RB◆◆RB◆◆LBcosLBθRB◆◆LB2RB◆◆RB=tanLBθRB◆◆LB2RB\frac◆LB◆1 - \cos\theta◆RB◆◆LB◆\sin\theta◆RB◆ = \frac◆LB◆1 - (1 - 2\sin^2\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆)◆RB◆◆LB◆2\sin\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆\cos\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆◆RB◆ = \frac◆LB◆2\sin^2\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆◆RB◆◆LB◆2\sin\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆\cos\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆◆RB◆ = \frac◆LB◆\sin\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆◆RB◆◆LB◆\cos\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆◆RB◆ = \tan\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ \quad \blacksquare

7.3 Sign Determination

The ±\pm in the sine and cosine half-angle formulas depends on the quadrant of LBθRB◆◆LB2RB\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆, not the quadrant of θ\theta itself. Always determine which quadrant LBθRB◆◆LB2RB\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ lies in before choosing the sign.

Quadrant of LBθRB◆◆LB2RB\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆sinLBθRB◆◆LB2RB\sin\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆cosLBθRB◆◆LB2RB\cos\frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆
I: 0<LBθRB◆◆LB2RB<LBπRB◆◆LB2RB0 \lt{} \frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ \lt{} \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆++++
II: LBπRB◆◆LB2RB<LBθRB◆◆LB2RB<π\frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆ \lt{} \frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ \lt{} \pi++-
III: π<LBθRB◆◆LB2RB<LB3πRB◆◆LB2RB\pi \lt{} \frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ \lt{} \frac◆LB◆3\pi◆RB◆◆LB◆2◆RB◆--
IV: LB3πRB◆◆LB2RB<LBθRB◆◆LB2RB<2π\frac◆LB◆3\pi◆RB◆◆LB◆2◆RB◆ \lt{} \frac◆LB◆\theta◆RB◆◆LB◆2◆RB◆ \lt{} 2\pi-++
Details

Worked example Find the exact value of sinLBπRB◆◆LB8RB\sin\frac◆LB◆\pi◆RB◆◆LB◆8◆RB◆.

Since 0<LBπRB◆◆LB8RB<LBπRB◆◆LB2RB0 \lt{} \frac◆LB◆\pi◆RB◆◆LB◆8◆RB◆ \lt{} \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆ (first quadrant), sinLBπRB◆◆LB8RB>0\sin\frac◆LB◆\pi◆RB◆◆LB◆8◆RB◆ > 0, so we take the positive root.

sinLBπRB◆◆LB8RB=LBLB1cosπ4RB◆◆LB2RB◆◆RB=LBLB122RB◆◆LB2RB◆◆RB=LBLB22RB◆◆LB4RB◆◆RB=LBLB22RB◆◆RB◆◆LB2RB\sin\frac◆LB◆\pi◆RB◆◆LB◆8◆RB◆ = \sqrt◆LB◆\frac◆LB◆1 - \cos\frac{\pi}{4}◆RB◆◆LB◆2◆RB◆◆RB◆ = \sqrt◆LB◆\frac◆LB◆1 - \frac{\sqrt{2}}{2}◆RB◆◆LB◆2◆RB◆◆RB◆ = \sqrt◆LB◆\frac◆LB◆2 - \sqrt{2}◆RB◆◆LB◆4◆RB◆◆RB◆ = \frac◆LB◆\sqrt◆LB◆2 - \sqrt{2}◆RB◆◆RB◆◆LB◆2◆RB◆


8. R-Addition Formula (Harmonic Form)

Theorem. For real numbers aa and bb:

asinθ+bcosθ=Rsin(θ+α)a\sin\theta + b\cos\theta = R\sin(\theta + \alpha)

where R=a2+b2R = \sqrt{a^2 + b^2} and tanα=ba\tan\alpha = \dfrac{b}{a}.

8.1 Cosine Form

Alternatively, the same expression can be written as:

asinθ+bcosθ=Rcos(θβ)a\sin\theta + b\cos\theta = R\cos(\theta - \beta)

where R=a2+b2R = \sqrt{a^2 + b^2} and tanβ=ab\tan\beta = \dfrac{a}{b}.

Both forms are equivalent; the choice between them is a matter of convenience depending on whether a sine or cosine expansion is more natural for the problem at hand.

8.2 Derivation

Expand the right-hand side of the sine form:

Rsin(θ+α)=Rsinθcosα+RcosθsinαR\sin(\theta + \alpha) = R\sin\theta\cos\alpha + R\cos\theta\sin\alpha

Equating coefficients with asinθ+bcosθa\sin\theta + b\cos\theta:

Rcosα=a,Rsinα=bR\cos\alpha = a, \qquad R\sin\alpha = b

Squaring and adding: R2cos2α+R2sin2α=a2+b2R^2\cos^2\alpha + R^2\sin^2\alpha = a^2 + b^2, so R2=a2+b2R^2 = a^2 + b^2 and R=a2+b2R = \sqrt{a^2 + b^2}.

Dividing the second equation by the first: tanα=ba\tan\alpha = \dfrac{b}{a}. \blacksquare

The cosine form is derived similarly by expanding Rcos(θβ)=Rcosθcosβ+RsinθsinβR\cos(\theta - \beta) = R\cos\theta\cos\beta + R\sin\theta\sin\beta and equating coefficients.

8.3 Applications: Maximum and Minimum

Since 1sin(θ+α)1-1 \leq \sin(\theta + \alpha) \leq 1:

Rasinθ+bcosθR-R \leq a\sin\theta + b\cos\theta \leq R

  • Maximum =R=a2+b2= R = \sqrt{a^2 + b^2}, occurring when θ+α=LBπRB◆◆LB2RB+2nπ\theta + \alpha = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆ + 2n\pi.
  • Minimum =R= -R, occurring when θ+α=LB3πRB◆◆LB2RB+2nπ\theta + \alpha = \frac◆LB◆3\pi◆RB◆◆LB◆2◆RB◆ + 2n\pi.
Details

Example: Finding maximum and minimum Find the maximum and minimum values of 3sinθ4cosθ3\sin\theta - 4\cos\theta and the values of θ\theta at which they occur, for 0θ<2π0 \leq \theta \lt{} 2\pi.

R=9+16=5R = \sqrt{9 + 16} = 5.

Here a=3a = 3 and b=4b = -4. Writing 3sinθ4cosθ=5sin(θ+α)3\sin\theta - 4\cos\theta = 5\sin(\theta + \alpha) where tanα=43\tan\alpha = \dfrac{-4}{3}, so α=arctan43\alpha = -\arctan\dfrac{4}{3}.

Maximum =5= 5 when θ+α=LBπRB◆◆LB2RB\theta + \alpha = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆:

θ=LBπRB◆◆LB2RBα=LBπRB◆◆LB2RB+arctan432.214rad\theta = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆ - \alpha = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆ + \arctan\frac{4}{3} \approx 2.214 \mathrm{ rad}

Minimum =5= -5 when θ+α=LB3πRB◆◆LB2RB\theta + \alpha = \frac◆LB◆3\pi◆RB◆◆LB◆2◆RB◆:

θ=LB3πRB◆◆LB2RBα=LB3πRB◆◆LB2RB+arctan435.356rad\theta = \frac◆LB◆3\pi◆RB◆◆LB◆2◆RB◆ - \alpha = \frac◆LB◆3\pi◆RB◆◆LB◆2◆RB◆ + \arctan\frac{4}{3} \approx 5.356 \mathrm{ rad}

8.4 Solving Equations

The R-addition formula converts asinθ+bcosθ=ka\sin\theta + b\cos\theta = k into Rsin(θ+α)=kR\sin(\theta + \alpha) = k, a standard trigonometric equation.

Details

Example: Solving an equation Solve sinθ+cosθ=1\sin\theta + \cos\theta = 1 for 0θ<2π0 \leq \theta \lt{} 2\pi.

R=1+1=2R = \sqrt{1 + 1} = \sqrt{2}, α=arctan1=LBπRB◆◆LB4RB\alpha = \arctan 1 = \frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆.

2sin ⁣(θ+LBπRB◆◆LB4RB)=1\sqrt{2}\sin\!\left(\theta + \frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆\right) = 1

sin ⁣(θ+LBπRB◆◆LB4RB)=LB1RB◆◆LB2RB=sinLBπRB◆◆LB4RB\sin\!\left(\theta + \frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆\right) = \frac◆LB◆1◆RB◆◆LB◆\sqrt{2}◆RB◆ = \sin\frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆

θ+LBπRB◆◆LB4RB=LBπRB◆◆LB4RB+2nπorθ+LBπRB◆◆LB4RB=LB3πRB◆◆LB4RB+2nπ\theta + \frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆ = \frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆ + 2n\pi \quad \mathrm{or} \quad \theta + \frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆ = \frac◆LB◆3\pi◆RB◆◆LB◆4◆RB◆ + 2n\pi

θ=2nπorθ=LBπRB◆◆LB2RB+2nπ\theta = 2n\pi \quad \mathrm{or} \quad \theta = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆ + 2n\pi

For 0θ<2π0 \leq \theta \lt{} 2\pi: θ=0\theta = 0 or θ=LBπRB◆◆LB2RB\theta = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆.


9. Trigonometric Identities: Proof Strategies

Proving trigonometric identities is a core exam skill. The following strategies cover the most common approaches.

9.1 Strategy 1: Work with One Side

Start from the more complicated side and simplify it until it matches the simpler side. This avoids the logical error of assuming what you are trying to prove.

9.2 Strategy 2: Express Everything in Sine and Cosine

Replace tan\tan, sec\sec, csc\csc, cot\cot with their definitions in terms of sin\sin and cos\cos: tanθ=LBsinθRB◆◆LBcosθRB\tan\theta = \frac◆LB◆\sin\theta◆RB◆◆LB◆\cos\theta◆RB◆, secθ=LB1RB◆◆LBcosθRB\sec\theta = \frac◆LB◆1◆RB◆◆LB◆\cos\theta◆RB◆, etc.

9.3 Strategy 3: Use Known Identities

Apply the Pythagorean identity, compound angle, or double angle formulas to create simplifications.

9.4 Strategy 4: Multiply by the Conjugate

When you see expressions of the form a±ba \pm b in a denominator or numerator, multiply top and bottom by the conjugate aba \mp b to produce a difference of squares.

Details

Example 1: Strategy 2 (express in sin and cos) Prove that cotA+tanA=LB2RB◆◆LBsin2ARB\cot A + \tan A = \dfrac◆LB◆2◆RB◆◆LB◆\sin 2A◆RB◆.

cotA+tanA=LBcosARB◆◆LBsinARB+LBsinARB◆◆LBcosARB=LBcos2A+sin2ARB◆◆LBsinAcosARB=LB1RB◆◆LBsinAcosARB=LB2RB◆◆LB2sinAcosARB=LB2RB◆◆LBsin2ARB\begin{aligned} \cot A + \tan A &= \frac◆LB◆\cos A◆RB◆◆LB◆\sin A◆RB◆ + \frac◆LB◆\sin A◆RB◆◆LB◆\cos A◆RB◆ \\ &= \frac◆LB◆\cos^2 A + \sin^2 A◆RB◆◆LB◆\sin A \cos A◆RB◆ \\ &= \frac◆LB◆1◆RB◆◆LB◆\sin A \cos A◆RB◆ \\ &= \frac◆LB◆2◆RB◆◆LB◆2\sin A \cos A◆RB◆ = \frac◆LB◆2◆RB◆◆LB◆\sin 2A◆RB◆ \quad \blacksquare \end{aligned}
Details

Example 2: Strategy 3 (use known identities) Prove that sin3A=3sinA4sin3A\sin 3A = 3\sin A - 4\sin^3 A.

sin3A=sin(2A+A)=sin2AcosA+cos2AsinA=2sinAcos2A+(12sin2A)sinA=2sinA(1sin2A)+sinA2sin3A=2sinA2sin3A+sinA2sin3A=3sinA4sin3A\begin{aligned} \sin 3A &= \sin(2A + A) \\ &= \sin 2A \cos A + \cos 2A \sin A \\ &= 2\sin A \cos^2 A + (1 - 2\sin^2 A)\sin A \\ &= 2\sin A(1 - \sin^2 A) + \sin A - 2\sin^3 A \\ &= 2\sin A - 2\sin^3 A + \sin A - 2\sin^3 A \\ &= 3\sin A - 4\sin^3 A \quad \blacksquare \end{aligned}
Details

Example 3: Strategy 4 (multiply by conjugate) Prove that LB1RB◆◆LBsecA+tanARB=secAtanA\dfrac◆LB◆1◆RB◆◆LB◆\sec A + \tan A◆RB◆ = \sec A - \tan A.

Multiply numerator and denominator by secAtanA\sec A - \tan A:

LB1RB◆◆LBsecA+tanARBLBsecAtanARB◆◆LBsecAtanARB=LBsecAtanARB◆◆LBsec2Atan2ARB=LBsecAtanARB◆◆LB1+tan2Atan2ARB=LBsecAtanARB◆◆LB1RB=secAtanA\begin{aligned} \frac◆LB◆1◆RB◆◆LB◆\sec A + \tan A◆RB◆ \cdot \frac◆LB◆\sec A - \tan A◆RB◆◆LB◆\sec A - \tan A◆RB◆ &= \frac◆LB◆\sec A - \tan A◆RB◆◆LB◆\sec^2 A - \tan^2 A◆RB◆ \\ &= \frac◆LB◆\sec A - \tan A◆RB◆◆LB◆1 + \tan^2 A - \tan^2 A◆RB◆ \\ &= \frac◆LB◆\sec A - \tan A◆RB◆◆LB◆1◆RB◆ \\ &= \sec A - \tan A \quad \blacksquare \end{aligned}

where we used sec2A=1+tan2A\sec^2 A = 1 + \tan^2 A so that sec2Atan2A=1\sec^2 A - \tan^2 A = 1.

Details

Example 4: Strategy 1 (work with one side) Prove that LBcos2ARB◆◆LB1+sin2ARB=LBcosAsinARB◆◆LBcosA+sinARB\dfrac◆LB◆\cos 2A◆RB◆◆LB◆1 + \sin 2A◆RB◆ = \dfrac◆LB◆\cos A - \sin A◆RB◆◆LB◆\cos A + \sin A◆RB◆.

Working from the LHS:

LBcos2ARB◆◆LB1+sin2ARB=LBcos2Asin2ARB◆◆LB1+2sinAcosARB=LB(cosAsinA)(cosA+sinA)RB◆◆LBcos2A+2sinAcosA+sin2ARB=LB(cosAsinA)(cosA+sinA)RB◆◆LB(cosA+sinA)2RB=LBcosAsinARB◆◆LBcosA+sinARB\begin{aligned} \frac◆LB◆\cos 2A◆RB◆◆LB◆1 + \sin 2A◆RB◆ &= \frac◆LB◆\cos^2 A - \sin^2 A◆RB◆◆LB◆1 + 2\sin A \cos A◆RB◆ \\ &= \frac◆LB◆(\cos A - \sin A)(\cos A + \sin A)◆RB◆◆LB◆\cos^2 A + 2\sin A\cos A + \sin^2 A◆RB◆ \\ &= \frac◆LB◆(\cos A - \sin A)(\cos A + \sin A)◆RB◆◆LB◆(\cos A + \sin A)^2◆RB◆ \\ &= \frac◆LB◆\cos A - \sin A◆RB◆◆LB◆\cos A + \sin A◆RB◆ \quad \blacksquare \end{aligned}

10. Trigonometric Graphs

10.1 Key Features

FunctionPeriodAmplitudeDomainRange
sinx\sin x2π2\pi11R\mathbb{R}[1,1][-1, 1]
cosx\cos x2π2\pi11R\mathbb{R}[1,1][-1, 1]
tanx\tan xπ\piundefinedxLBπRB◆◆LB2RB+nπx \neq \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆ + n\piR\mathbb{R}

Key values of sin\sin and cos\cos:

Angle00LBπRB◆◆LB6RB\frac◆LB◆\pi◆RB◆◆LB◆6◆RB◆LBπRB◆◆LB4RB\frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆LBπRB◆◆LB3RB\frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆LBπRB◆◆LB2RB\frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆π\piLB3πRB◆◆LB2RB\frac◆LB◆3\pi◆RB◆◆LB◆2◆RB◆2π2\pi
sin\sin0012\frac{1}{2}LB2RB◆◆LB2RB\frac◆LB◆\sqrt{2}◆RB◆◆LB◆2◆RB◆LB3RB◆◆LB2RB\frac◆LB◆\sqrt{3}◆RB◆◆LB◆2◆RB◆11001-100
cos\cos11LB3RB◆◆LB2RB\frac◆LB◆\sqrt{3}◆RB◆◆LB◆2◆RB◆LB2RB◆◆LB2RB\frac◆LB◆\sqrt{2}◆RB◆◆LB◆2◆RB◆12\frac{1}{2}001-10011

10.2 Transformations

For the general form y=Asin(Bx+C)+Dy = A\sin(Bx + C) + D (and similarly for cos\cos):

  • A|A| is the amplitude (vertical stretch from the midline)
  • The period is LB2πRB◆◆LBBRB\dfrac◆LB◆2\pi◆RB◆◆LB◆|B|◆RB◆
  • The phase shift is CB-\dfrac{C}{B} (horizontal shift)
  • DD is the vertical shift (midline is y=Dy = D)

For tan\tan, the period is LBπRB◆◆LBBRB\dfrac◆LB◆\pi◆RB◆◆LB◆|B|◆RB◆ and amplitude is not defined.

y = A sin(Bx + C) + D

Use the sliders to adjust the amplitude, period, phase shift, and vertical translation of the trigonometric functions. Observe how each parameter affects the graph of y=Asin(Bx+C)+Dy = A\sin(Bx + C) + D.

Details

Worked example Describe the key features of y=2sin ⁣(2xLBπRB◆◆LB3RB)y = 2\sin\!\left(2x - \frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆\right) for 0x2π0 \leq x \leq 2\pi.

Amplitude: A=2|A| = 2, so the range is [2,2][-2, 2].

Period: LB2πRB◆◆LBBRB=LB2πRB◆◆LB2RB=π\dfrac◆LB◆2\pi◆RB◆◆LB◆|B|◆RB◆ = \dfrac◆LB◆2\pi◆RB◆◆LB◆2◆RB◆ = \pi.

Phase shift: CB=LBπ/3RB◆◆LB2RB=LBπRB◆◆LB6RB-\dfrac{C}{B} = -\dfrac◆LB◆-\pi/3◆RB◆◆LB◆2◆RB◆ = \dfrac◆LB◆\pi◆RB◆◆LB◆6◆RB◆ (shift right by LBπRB◆◆LB6RB\frac◆LB◆\pi◆RB◆◆LB◆6◆RB◆).

Key points. The first cycle begins at x=LBπRB◆◆LB6RBx = \frac◆LB◆\pi◆RB◆◆LB◆6◆RB◆ (where the curve crosses the midline upward). Subsequent key points within [0,2π][0, 2\pi]:

  • Maximum at x=LB5πRB◆◆LB12RBx = \frac◆LB◆5\pi◆RB◆◆LB◆12◆RB◆ (value 22)
  • Midline crossing (down) at x=LB2πRB◆◆LB3RBx = \frac◆LB◆2\pi◆RB◆◆LB◆3◆RB◆
  • Minimum at x=LB11πRB◆◆LB12RBx = \frac◆LB◆11\pi◆RB◆◆LB◆12◆RB◆ (value 2-2)
  • Midline crossing (up) at x=LB7πRB◆◆LB6RBx = \frac◆LB◆7\pi◆RB◆◆LB◆6◆RB◆

Since the period is π\pi, the second cycle repeats with all xx-values shifted by π\pi:

  • Maximum at x=LB17πRB◆◆LB12RBx = \frac◆LB◆17\pi◆RB◆◆LB◆12◆RB◆ (value 22)
  • Minimum at x=LB23πRB◆◆LB12RBx = \frac◆LB◆23\pi◆RB◆◆LB◆12◆RB◆ (value 2-2)

yy-intercept: y=2sin ⁣(LBπRB◆◆LB3RB)=31.73y = 2\sin\!\left(-\frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆\right) = -\sqrt{3} \approx -1.73.


11. Problem Set

Problem 1. Prove that LBsin2θRB◆◆LB1+cos2θRB=tanθ\frac◆LB◆\sin 2\theta◆RB◆◆LB◆1 + \cos 2\theta◆RB◆ = \tan\theta.

Solution
LBsin2θRB◆◆LB1+cos2θRB=LB2sinθcosθRB◆◆LB1+(2cos2θ1)RB=LB2sinθcosθRB◆◆LB2cos2θRB=LBsinθRB◆◆LBcosθRB=tanθ\begin{aligned} \frac◆LB◆\sin 2\theta◆RB◆◆LB◆1 + \cos 2\theta◆RB◆ &= \frac◆LB◆2\sin\theta\cos\theta◆RB◆◆LB◆1 + (2\cos^2\theta - 1)◆RB◆ \\ &= \frac◆LB◆2\sin\theta\cos\theta◆RB◆◆LB◆2\cos^2\theta◆RB◆ \\ &= \frac◆LB◆\sin\theta◆RB◆◆LB◆\cos\theta◆RB◆ = \tan\theta \quad \blacksquare \end{aligned}

If you get this wrong, revise: Double angle formulas


Problem 2. Solve sin2x=sinx\sin 2x = \sin x for 0x<2π0 \leq x < 2\pi.

Details

Solution 2sinxcosx=sinx2\sin x\cos x = \sin x

sinx(2cosx1)=0\sin x(2\cos x - 1) = 0

sinx=0    x=0,π\sin x = 0 \implies x = 0, \pi.

2cosx1=0    cosx=12    x=LBπRB◆◆LB3RB,LB5πRB◆◆LB3RB2\cos x - 1 = 0 \implies \cos x = \frac{1}{2} \implies x = \frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆, \frac◆LB◆5\pi◆RB◆◆LB◆3◆RB◆.

Solutions: x=0,LBπRB◆◆LB3RB,π,LB5πRB◆◆LB3RBx = 0, \frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆, \pi, \frac◆LB◆5\pi◆RB◆◆LB◆3◆RB◆.

If you get this wrong, revise: Solving trig equations


Problem 3. Express 4sinθ3cosθ4\sin\theta - 3\cos\theta in the form Rsin(θα)R\sin(\theta - \alpha), where R>0R > 0 and 0<α<LBπRB◆◆LB2RB0 < \alpha < \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆.

Details

Solution Rsin(θα)=R(sinθcosαcosθsinα)=RcosαsinθRsinαcosθR\sin(\theta - \alpha) = R(\sin\theta\cos\alpha - \cos\theta\sin\alpha) = R\cos\alpha\sin\theta - R\sin\alpha\cos\theta.

Comparing coefficients: Rcosα=4R\cos\alpha = 4 and Rsinα=3R\sin\alpha = 3.

R2=42+32=25    R=5R^2 = 4^2 + 3^2 = 25 \implies R = 5

tanα=34    α=arctan(34)0.6435rad\tan\alpha = \frac{3}{4} \implies \alpha = \arctan\left(\frac{3}{4}\right) \approx 0.6435 \mathrm{ rad}

4sinθ3cosθ=5sin(θ0.6435)4\sin\theta - 3\cos\theta = 5\sin(\theta - 0.6435)

If you get this wrong, revise: Compound angle formulas


Problem 4. Find the exact value of sin75\sin 75^\circ.

Details

Solution sin75°=sin(45°+30°)=sin45°cos30°+cos45°sin30\sin 75° = \sin(45° + 30°) = \sin 45°\cos 30° + \cos 45°\sin 30^\circ

=LB2RB◆◆LB2RBLB3RB◆◆LB2RB+LB2RB◆◆LB2RB12=LB6+2RB◆◆LB4RB= \frac◆LB◆\sqrt{2}◆RB◆◆LB◆2◆RB◆ \cdot \frac◆LB◆\sqrt{3}◆RB◆◆LB◆2◆RB◆ + \frac◆LB◆\sqrt{2}◆RB◆◆LB◆2◆RB◆ \cdot \frac{1}{2} = \frac◆LB◆\sqrt{6} + \sqrt{2}◆RB◆◆LB◆4◆RB◆

If you get this wrong, revise: Compound angle formulas


Problem 5. Prove that LB1cos2θRB◆◆LBsin2θRB=tanθ\frac◆LB◆1 - \cos 2\theta◆RB◆◆LB◆\sin 2\theta◆RB◆ = \tan\theta.

Solution
LB1cos2θRB◆◆LBsin2θRB=LB1(12sin2θ)RB◆◆LB2sinθcosθRB=LB2sin2θRB◆◆LB2sinθcosθRB=LBsinθRB◆◆LBcosθRB=tanθ\begin{aligned} \frac◆LB◆1 - \cos 2\theta◆RB◆◆LB◆\sin 2\theta◆RB◆ &= \frac◆LB◆1 - (1 - 2\sin^2\theta)◆RB◆◆LB◆2\sin\theta\cos\theta◆RB◆ \\ &= \frac◆LB◆2\sin^2\theta◆RB◆◆LB◆2\sin\theta\cos\theta◆RB◆ \\ &= \frac◆LB◆\sin\theta◆RB◆◆LB◆\cos\theta◆RB◆ = \tan\theta \quad \blacksquare \end{aligned}

If you get this wrong, revise: Double angle formulas


Problem 6. A sector of a circle of radius 8 cm has an angle of 1.2 radians. Find the arc length and the area of the sector.

Details

Solution Arc length: s=rθ=8×1.2=9.6s = r\theta = 8 \times 1.2 = 9.6 cm.

Area: A=12r2θ=12(64)(1.2)=38.4A = \frac{1}{2}r^2\theta = \frac{1}{2}(64)(1.2) = 38.4 cm².

If you get this wrong, revise: Radian measure


Problem 7. Solve 3cos2x+2sinx2=03\cos^2 x + 2\sin x - 2 = 0 for πxπ-\pi \leq x \leq \pi.

Details

Solution 3(1sin2x)+2sinx2=03(1 - \sin^2 x) + 2\sin x - 2 = 0

33sin2x+2sinx2=03 - 3\sin^2 x + 2\sin x - 2 = 0

3sin2x+2sinx+1=0-3\sin^2 x + 2\sin x + 1 = 0

3sin2x2sinx1=03\sin^2 x - 2\sin x - 1 = 0

(3sinx+1)(sinx1)=0(3\sin x + 1)(\sin x - 1) = 0

sinx=13    x=arcsin(13)0.3398\sin x = -\frac{1}{3} \implies x = \arcsin(-\frac{1}{3}) \approx -0.3398 or x=πarcsin(13)=π+0.33982.802x = -\pi - \arcsin(-\frac{1}{3}) = -\pi + 0.3398 \approx -2.802 (since 3.481>π3.481 > \pi, subtract 2π2\pi to stay in [π,π][-\pi, \pi]).

sinx=1    x=LBπRB◆◆LB2RB\sin x = 1 \implies x = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆.

Solutions: x2.802,0.340,LBπRB◆◆LB2RBx \approx -2.802, -0.340, \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆.

If you get this wrong, revise: Solving trig equations


Problem 8. Use small angle approximations to estimate LBsin0.05RB◆◆LBcos0.05RB\frac◆LB◆\sin 0.05◆RB◆◆LB◆\cos 0.05◆RB◆.

Details

Solution sin0.050.05\sin 0.05 \approx 0.05

cos0.0510.0522=10.00125=0.99875\cos 0.05 \approx 1 - \frac{0.05^2}{2} = 1 - 0.00125 = 0.99875

LBsin0.05RB◆◆LBcos0.05RB0.050.998750.05006\frac◆LB◆\sin 0.05◆RB◆◆LB◆\cos 0.05◆RB◆ \approx \frac{0.05}{0.99875} \approx 0.05006

(Alternatively, tan0.050.05\tan 0.05 \approx 0.05 directly.)

If you get this wrong, revise: Small angle approximations


Problem 9. Prove that LB1+sin2ARB◆◆LBcos2ARB=tan ⁣(A+LBπRB◆◆LB4RB)\dfrac◆LB◆1 + \sin 2A◆RB◆◆LB◆\cos 2A◆RB◆ = \tan\!\left(A + \dfrac◆LB◆\pi◆RB◆◆LB◆4◆RB◆\right).

Details

Solution Working from the LHS:

LB1+sin2ARB◆◆LBcos2ARB=LB1+2sinAcosARB◆◆LBcos2Asin2ARB=LBsin2A+2sinAcosA+cos2ARB◆◆LB(cosAsinA)(cosA+sinA)RB=LB(sinA+cosA)2RB◆◆LB(cosAsinA)(cosA+sinA)RB=LBsinA+cosARB◆◆LBcosAsinARB\begin{aligned} \frac◆LB◆1 + \sin 2A◆RB◆◆LB◆\cos 2A◆RB◆ &= \frac◆LB◆1 + 2\sin A \cos A◆RB◆◆LB◆\cos^2 A - \sin^2 A◆RB◆ \\ &= \frac◆LB◆\sin^2 A + 2\sin A \cos A + \cos^2 A◆RB◆◆LB◆(\cos A - \sin A)(\cos A + \sin A)◆RB◆ \\ &= \frac◆LB◆(\sin A + \cos A)^2◆RB◆◆LB◆(\cos A - \sin A)(\cos A + \sin A)◆RB◆ \\ &= \frac◆LB◆\sin A + \cos A◆RB◆◆LB◆\cos A - \sin A◆RB◆ \end{aligned}

Dividing numerator and denominator by cosA\cos A:

=LBtanA+1RB◆◆LB1tanARB= \frac◆LB◆\tan A + 1◆RB◆◆LB◆1 - \tan A◆RB◆

From the tangent compound angle formula:

tan ⁣(A+LBπRB◆◆LB4RB)=LBtanA+tanLBπRB◆◆LB4RB◆◆RB◆◆LB1tanAtanLBπRB◆◆LB4RB◆◆RB=LBtanA+1RB◆◆LB1tanARB\tan\!\left(A + \frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆\right) = \frac◆LB◆\tan A + \tan\frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆◆RB◆◆LB◆1 - \tan A \tan\frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆◆RB◆ = \frac◆LB◆\tan A + 1◆RB◆◆LB◆1 - \tan A◆RB◆ \quad \blacksquare

If you get this wrong, revise: Compound angle formulas


Problem 10. The area of a sector is 20cm220\mathrm{ cm}^2 and the arc length is 10cm10\mathrm{ cm}. Find the radius and the angle.

Details

Solution s=rθ=10    θ=10rs = r\theta = 10 \implies \theta = \frac{10}{r}

A=12r2θ=12r210r=5r=20    r=4A = \frac{1}{2}r^2\theta = \frac{1}{2}r^2 \cdot \frac{10}{r} = 5r = 20 \implies r = 4

θ=104=2.5radians\theta = \frac{10}{4} = 2.5 \mathrm{ radians}

If you get this wrong, revise: Radian measure


Problem 11. Find the exact value of cosLBπRB◆◆LB12RB\cos\dfrac◆LB◆\pi◆RB◆◆LB◆12◆RB◆ using a half-angle formula.

Details

Solution cosLBπRB◆◆LB12RB=cosLBπ/6RB◆◆LB2RB\cos\frac◆LB◆\pi◆RB◆◆LB◆12◆RB◆ = \cos\frac◆LB◆\pi/6◆RB◆◆LB◆2◆RB◆, so we apply the half-angle formula with θ=LBπRB◆◆LB6RB\theta = \frac◆LB◆\pi◆RB◆◆LB◆6◆RB◆.

Since 0<LBπRB◆◆LB12RB<LBπRB◆◆LB2RB0 \lt{} \frac◆LB◆\pi◆RB◆◆LB◆12◆RB◆ \lt{} \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆ (first quadrant), cosLBπRB◆◆LB12RB>0\cos\frac◆LB◆\pi◆RB◆◆LB◆12◆RB◆ > 0.

cosLBπRB◆◆LB12RB=LBLB1+cosπ6RB◆◆LB2RB◆◆RB=LBLB1+32RB◆◆LB2RB◆◆RB=LBLB2+3RB◆◆LB4RB◆◆RB=LBLB2+3RB◆◆RB◆◆LB2RB\begin{aligned} \cos\frac◆LB◆\pi◆RB◆◆LB◆12◆RB◆ &= \sqrt◆LB◆\frac◆LB◆1 + \cos\frac{\pi}{6}◆RB◆◆LB◆2◆RB◆◆RB◆ \\ &= \sqrt◆LB◆\frac◆LB◆1 + \frac{\sqrt{3}}{2}◆RB◆◆LB◆2◆RB◆◆RB◆ \\ &= \sqrt◆LB◆\frac◆LB◆2 + \sqrt{3}◆RB◆◆LB◆4◆RB◆◆RB◆ \\ &= \frac◆LB◆\sqrt◆LB◆2 + \sqrt{3}◆RB◆◆RB◆◆LB◆2◆RB◆ \end{aligned}

This can also be verified using the compound angle formula: cosLBπRB◆◆LB12RB=cos ⁣(LBπRB◆◆LB3RBLBπRB◆◆LB4RB)=cosLBπRB◆◆LB3RBcosLBπRB◆◆LB4RB+sinLBπRB◆◆LB3RBsinLBπRB◆◆LB4RB=LB6+2RB◆◆LB4RB\cos\frac◆LB◆\pi◆RB◆◆LB◆12◆RB◆ = \cos\!\left(\frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆ - \frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆\right) = \cos\frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆\cos\frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆ + \sin\frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆\sin\frac◆LB◆\pi◆RB◆◆LB◆4◆RB◆ = \frac◆LB◆\sqrt{6} + \sqrt{2}◆RB◆◆LB◆4◆RB◆, and one can check that LBLB2+3RB◆◆RB◆◆LB2RB=LB6+2RB◆◆LB4RB\dfrac◆LB◆\sqrt◆LB◆2+\sqrt{3}◆RB◆◆RB◆◆LB◆2◆RB◆ = \dfrac◆LB◆\sqrt{6}+\sqrt{2}◆RB◆◆LB◆4◆RB◆.

If you get this wrong, revise: Half-angle formulas


Problem 12. Find the maximum value of 2sinθ+5cosθ2\sin\theta + 5\cos\theta and the smallest positive value of θ\theta at which it occurs.

Details

Solution R=4+25=29R = \sqrt{4 + 25} = \sqrt{29}.

The maximum value is R=29R = \sqrt{29}.

Writing 2sinθ+5cosθ=29sin(θ+α)2\sin\theta + 5\cos\theta = \sqrt{29}\sin(\theta + \alpha) where tanα=52\tan\alpha = \dfrac{5}{2}.

The maximum occurs when sin(θ+α)=1\sin(\theta + \alpha) = 1, i.e., θ+α=LBπRB◆◆LB2RB\theta + \alpha = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆.

θ=LBπRB◆◆LB2RBα=LBπRB◆◆LB2RBarctan520.3805rad\theta = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆ - \alpha = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆ - \arctan\frac{5}{2} \approx 0.3805 \mathrm{ rad}

Since arctan521.1903<LBπRB◆◆LB2RB\arctan\frac{5}{2} \approx 1.1903 < \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆, this θ\theta is positive and is the smallest positive value.

If you get this wrong, revise: R-addition formula


Problem 13. Prove that LBsin3ARB◆◆LBsinARBLBcos3ARB◆◆LBcosARB=2\dfrac◆LB◆\sin 3A◆RB◆◆LB◆\sin A◆RB◆ - \dfrac◆LB◆\cos 3A◆RB◆◆LB◆\cos A◆RB◆ = 2.

Solution
LBsin3ARB◆◆LBsinARBLBcos3ARB◆◆LBcosARB=LBsin3AcosAcos3AsinARB◆◆LBsinAcosARB=LBsin(3AA)RB◆◆LBsinAcosARB=LBsin2ARB◆◆LBsinAcosARB=LB2sinAcosARB◆◆LBsinAcosARB=2\begin{aligned} \frac◆LB◆\sin 3A◆RB◆◆LB◆\sin A◆RB◆ - \frac◆LB◆\cos 3A◆RB◆◆LB◆\cos A◆RB◆ &= \frac◆LB◆\sin 3A \cos A - \cos 3A \sin A◆RB◆◆LB◆\sin A \cos A◆RB◆ \\ &= \frac◆LB◆\sin(3A - A)◆RB◆◆LB◆\sin A \cos A◆RB◆ \\ &= \frac◆LB◆\sin 2A◆RB◆◆LB◆\sin A \cos A◆RB◆ \\ &= \frac◆LB◆2\sin A \cos A◆RB◆◆LB◆\sin A \cos A◆RB◆ \\ &= 2 \quad \blacksquare \end{aligned}

If you get this wrong, revise: Proof strategies


Problem 14. Solve sinθ+3cosθ=1\sin\theta + \sqrt{3}\cos\theta = 1 for 0θ<2π0 \leq \theta \lt{} 2\pi.

Details

Solution R=1+3=2R = \sqrt{1 + 3} = 2, α=arctan3=LBπRB◆◆LB3RB\alpha = \arctan\sqrt{3} = \frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆.

2sin ⁣(θ+LBπRB◆◆LB3RB)=12\sin\!\left(\theta + \frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆\right) = 1

sin ⁣(θ+LBπRB◆◆LB3RB)=12\sin\!\left(\theta + \frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆\right) = \frac{1}{2}

θ+LBπRB◆◆LB3RB=LBπRB◆◆LB6RB+2nπorθ+LBπRB◆◆LB3RB=LB5πRB◆◆LB6RB+2nπ\theta + \frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆ = \frac◆LB◆\pi◆RB◆◆LB◆6◆RB◆ + 2n\pi \quad \mathrm{or} \quad \theta + \frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆ = \frac◆LB◆5\pi◆RB◆◆LB◆6◆RB◆ + 2n\pi

Case 1: θ=LBπRB◆◆LB6RBLBπRB◆◆LB3RB+2nπ=LBπRB◆◆LB6RB+2nπ\theta = \frac◆LB◆\pi◆RB◆◆LB◆6◆RB◆ - \frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆ + 2n\pi = -\frac◆LB◆\pi◆RB◆◆LB◆6◆RB◆ + 2n\pi.

For n=1n = 1: θ=LBπRB◆◆LB6RB+2π=LB11πRB◆◆LB6RB\theta = -\frac◆LB◆\pi◆RB◆◆LB◆6◆RB◆ + 2\pi = \frac◆LB◆11\pi◆RB◆◆LB◆6◆RB◆.

Case 2: θ=LB5πRB◆◆LB6RBLBπRB◆◆LB3RB+2nπ=LBπRB◆◆LB2RB+2nπ\theta = \frac◆LB◆5\pi◆RB◆◆LB◆6◆RB◆ - \frac◆LB◆\pi◆RB◆◆LB◆3◆RB◆ + 2n\pi = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆ + 2n\pi.

For n=0n = 0: θ=LBπRB◆◆LB2RB\theta = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆.

Solutions: θ=LBπRB◆◆LB2RB\theta = \frac◆LB◆\pi◆RB◆◆LB◆2◆RB◆ or θ=LB11πRB◆◆LB6RB\theta = \frac◆LB◆11\pi◆RB◆◆LB◆6◆RB◆.

If you get this wrong, revise: R-addition formula


Problem 15. Prove that LB1tan2ARB◆◆LB1+tan2ARB=cos2A\dfrac◆LB◆1 - \tan^2 A◆RB◆◆LB◆1 + \tan^2 A◆RB◆ = \cos 2A.

Details

Solution Using sec2A=1+tan2A\sec^2 A = 1 + \tan^2 A:

LB1tan2ARB◆◆LB1+tan2ARB=LB1tan2ARB◆◆LBsec2ARB=(1tan2A)cos2A=cos2Atan2Acos2A=cos2ALBsin2ARB◆◆LBcos2ARBcos2A=cos2Asin2A=cos2A\begin{aligned} \frac◆LB◆1 - \tan^2 A◆RB◆◆LB◆1 + \tan^2 A◆RB◆ &= \frac◆LB◆1 - \tan^2 A◆RB◆◆LB◆\sec^2 A◆RB◆ \\ &= (1 - \tan^2 A)\cos^2 A \\ &= \cos^2 A - \tan^2 A \cos^2 A \\ &= \cos^2 A - \frac◆LB◆\sin^2 A◆RB◆◆LB◆\cos^2 A◆RB◆ \cdot \cos^2 A \\ &= \cos^2 A - \sin^2 A \\ &= \cos 2A \quad \blacksquare \end{aligned}

If you get this wrong, revise: Proof strategies


tip

tip Ready to test your understanding of Trigonometry? The diagnostic test contains the hardest questions within the A-Level specification for this topic, each with a full worked solution.

Unit tests probe edge cases and common misconceptions. Integration tests combine Trigonometry with other pure mathematics topics to test synthesis under exam conditions.

See Diagnostic Guide for instructions on self-marking and building a personal test matrix.